The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S)-1-amino-1-oxo-3-phenylpropan-2-ylamino)-5-guanidino-1-oxopentan-2-yl)-3,4-dichlorobenzamide ID: ALA2208331
PubChem CID: 10143123
Max Phase: Preclinical
Molecular Formula: C22H26Cl2N6O3
Molecular Weight: 493.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C22H26Cl2N6O3/c23-15-9-8-14(12-16(15)24)20(32)29-17(7-4-10-28-22(26)27)21(33)30-18(19(25)31)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12,17-18H,4,7,10-11H2,(H2,25,31)(H,29,32)(H,30,33)(H4,26,27,28)/t17-,18-/m0/s1
Standard InChI Key: JIKAORMZYVXNRV-ROUUACIJSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
6.0877 -30.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7954 -29.6789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3800 -29.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0877 -30.9047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3800 -28.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6722 -30.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9645 -29.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2568 -30.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9645 -28.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0877 -28.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0877 -27.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3800 -27.2273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3800 -26.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6722 -26.0015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0877 -26.0015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5031 -30.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2108 -29.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9185 -30.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2108 -28.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5031 -30.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2108 -31.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2063 -32.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9132 -32.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6219 -32.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6192 -31.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9118 -30.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5498 -29.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8426 -30.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8421 -30.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5548 -31.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2591 -30.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1351 -29.6746 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.1350 -31.3111 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 1
3 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
16 20 1 6
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 8 1 0
28 32 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.40Molecular Weight (Monoisotopic): 492.1443AlogP: 1.57#Rotatable Bonds: 11Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.88CX Basic pKa: 12.18CX LogP: 1.32CX LogD: -0.70Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.16Np Likeness Score: -0.50
References 1. Gealageas R, Schneider S, Humbert JP, Bertin I, Schmitt M, Laboureyras E, Dugave C, Mollereau C, Simonnet G, Bourguignon JJ, Simonin F, Bihel F.. (2012) Development of sub-nanomolar dipeptidic ligands of neuropeptide FF receptors., 22 (24): [PMID:23131340 ] [10.1016/j.bmcl.2012.10.049 ]