The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S)-1-amino-1-oxo-3-phenylpropan-2-ylamino)-5-guanidino-1-oxopentan-2-yl)-4-methoxybenzamide ID: ALA2208335
PubChem CID: 10184880
Max Phase: Preclinical
Molecular Formula: C23H30N6O4
Molecular Weight: 454.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(N)=O)cc1
Standard InChI: InChI=1S/C23H30N6O4/c1-33-17-11-9-16(10-12-17)21(31)28-18(8-5-13-27-23(25)26)22(32)29-19(20(24)30)14-15-6-3-2-4-7-15/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H2,24,30)(H,28,31)(H,29,32)(H4,25,26,27)/t18-,19-/m0/s1
Standard InChI Key: XDLDWLLAJBXAFU-OALUTQOASA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
5.9473 -14.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6550 -13.6611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2396 -13.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -14.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2396 -12.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5319 -14.0697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8242 -13.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1165 -14.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8242 -12.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -12.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -11.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2396 -11.2096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2396 -10.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5319 -9.9838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -9.9838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3628 -14.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0705 -13.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7782 -14.0697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0705 -12.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3628 -14.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0705 -15.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0660 -16.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7729 -16.5223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4815 -16.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4789 -15.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7715 -14.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4095 -13.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7022 -14.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7018 -14.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4145 -15.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1188 -14.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9946 -15.2933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2864 -14.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 1
3 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
16 20 1 6
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 8 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.2329AlogP: 0.27#Rotatable Bonds: 12Polar Surface Area: 172.42Molecular Species: BASEHBA: 5HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.17CX Basic pKa: 11.73CX LogP: 0.00CX LogD: -2.07Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.15Np Likeness Score: -0.20
References 1. Gealageas R, Schneider S, Humbert JP, Bertin I, Schmitt M, Laboureyras E, Dugave C, Mollereau C, Simonnet G, Bourguignon JJ, Simonin F, Bihel F.. (2012) Development of sub-nanomolar dipeptidic ligands of neuropeptide FF receptors., 22 (24): [PMID:23131340 ] [10.1016/j.bmcl.2012.10.049 ]