N-((R)-1-((S)-1-amino-1-oxo-3-phenylpropan-2-ylamino)-5-guanidino-1-oxopentan-2-yl)biphenyl-2-carboxamide

ID: ALA2208338

PubChem CID: 71463278

Max Phase: Preclinical

Molecular Formula: C28H32N6O3

Molecular Weight: 500.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H](NC(=O)c1ccccc1-c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O

Standard InChI:  InChI=1S/C28H32N6O3/c29-25(35)24(18-19-10-3-1-4-11-19)34-27(37)23(16-9-17-32-28(30)31)33-26(36)22-15-8-7-14-21(22)20-12-5-2-6-13-20/h1-8,10-15,23-24H,9,16-18H2,(H2,29,35)(H,33,36)(H,34,37)(H4,30,31,32)/t23-,24+/m1/s1

Standard InChI Key:  OLITVZQCNVWUKT-RPWUZVMVSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   16.4553  -21.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1630  -21.4244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7476  -21.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4553  -22.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7476  -20.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0398  -21.8330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3321  -21.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6244  -21.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3321  -20.6073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4553  -20.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4553  -19.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7476  -18.9729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7476  -18.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0398  -17.7471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4553  -17.7471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8707  -21.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5784  -21.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2861  -21.8330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5784  -20.6073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8707  -22.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5784  -23.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5739  -23.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2808  -24.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9895  -23.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9868  -23.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2794  -22.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9174  -21.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2102  -21.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2097  -22.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9224  -23.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6267  -22.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9175  -20.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6278  -20.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6299  -19.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9225  -18.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2116  -19.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2129  -20.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  6
  3  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
  2 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 16 20  1  6
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  8 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  8  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NPFFR2 Tchem Neuropeptide FF receptor 2 (533 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NPFFR1 Tchem Neuropeptide FF receptor 1 (514 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2536AlogP: 1.93#Rotatable Bonds: 12
Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.54CX Basic pKa: 11.82CX LogP: 1.84CX LogD: -0.27
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -0.21

References

1. Gealageas R, Schneider S, Humbert JP, Bertin I, Schmitt M, Laboureyras E, Dugave C, Mollereau C, Simonnet G, Bourguignon JJ, Simonin F, Bihel F..  (2012)  Development of sub-nanomolar dipeptidic ligands of neuropeptide FF receptors.,  22  (24): [PMID:23131340] [10.1016/j.bmcl.2012.10.049]

Source