The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((R)-1-((S)-1-amino-1-oxo-3-phenylpropan-2-ylamino)-5-guanidino-1-oxopentan-2-yl)biphenyl-2-carboxamide ID: ALA2208338
PubChem CID: 71463278
Max Phase: Preclinical
Molecular Formula: C28H32N6O3
Molecular Weight: 500.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](NC(=O)c1ccccc1-c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C28H32N6O3/c29-25(35)24(18-19-10-3-1-4-11-19)34-27(37)23(16-9-17-32-28(30)31)33-26(36)22-15-8-7-14-21(22)20-12-5-2-6-13-20/h1-8,10-15,23-24H,9,16-18H2,(H2,29,35)(H,33,36)(H,34,37)(H4,30,31,32)/t23-,24+/m1/s1
Standard InChI Key: OLITVZQCNVWUKT-RPWUZVMVSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
16.4553 -21.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1630 -21.4244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7476 -21.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4553 -22.6502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7476 -20.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0398 -21.8330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3321 -21.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6244 -21.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3321 -20.6073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4553 -20.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4553 -19.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7476 -18.9729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7476 -18.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0398 -17.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4553 -17.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8707 -21.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5784 -21.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2861 -21.8330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5784 -20.6073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8707 -22.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5784 -23.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5739 -23.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2808 -24.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9895 -23.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9868 -23.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2794 -22.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9174 -21.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2102 -21.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2097 -22.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9224 -23.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6267 -22.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9175 -20.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6278 -20.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6299 -19.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9225 -18.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2116 -19.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2129 -20.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 6
3 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
16 20 1 6
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 8 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2536AlogP: 1.93#Rotatable Bonds: 12Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: 11.82CX LogP: 1.84CX LogD: -0.27Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -0.21
References 1. Gealageas R, Schneider S, Humbert JP, Bertin I, Schmitt M, Laboureyras E, Dugave C, Mollereau C, Simonnet G, Bourguignon JJ, Simonin F, Bihel F.. (2012) Development of sub-nanomolar dipeptidic ligands of neuropeptide FF receptors., 22 (24): [PMID:23131340 ] [10.1016/j.bmcl.2012.10.049 ]