The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(4-(4-(5-(2-methoxyethyl)-2,4,6-trioxo-hexahydropyrimidin-5-yloxy)phenoxy)phenyl)oxazol-4-yl)benzonitrile ID: ALA222077
PubChem CID: 10239619
Max Phase: Preclinical
Molecular Formula: C29H22N4O7
Molecular Weight: 538.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCC1(Oc2ccc(Oc3ccc(-c4nc(-c5ccc(C#N)cc5)co4)cc3)cc2)C(=O)NC(=O)NC1=O
Standard InChI: InChI=1S/C29H22N4O7/c1-37-15-14-29(26(34)32-28(36)33-27(29)35)40-23-12-10-22(11-13-23)39-21-8-6-20(7-9-21)25-31-24(17-38-25)19-4-2-18(16-30)3-5-19/h2-13,17H,14-15H2,1H3,(H2,32,33,34,35,36)
Standard InChI Key: YDTQINPZBUBYRX-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-4.8816 -6.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4730 -6.7784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6560 -6.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2412 -6.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6498 -5.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4730 -5.3553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7070 -6.0648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2341 -4.6465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2465 -7.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8347 -5.3527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6596 -6.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8342 -6.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4215 -7.3682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5961 -7.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0093 -5.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5985 -6.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7739 -6.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3603 -5.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7775 -4.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6007 -4.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4651 -5.3537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8787 -6.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4660 -6.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8789 -7.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7052 -7.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1169 -6.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7015 -6.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1249 -8.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7911 -8.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4060 -9.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1198 -9.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9459 -8.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8710 -9.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9584 -10.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7125 -10.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3799 -10.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2883 -9.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5340 -8.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1354 -10.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8867 -10.7619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
20 15 1 0
4 10 1 0
18 21 1 0
3 4 1 0
21 22 1 0
4 11 1 0
22 23 2 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 2 0
5 6 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 22 1 0
28 29 1 0
13 14 1 0
1 7 2 0
10 15 1 0
1 2 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 2 0
25 28 1 0
15 16 2 0
5 8 2 0
33 34 2 0
16 17 1 0
34 35 1 0
1 6 1 0
35 36 2 0
17 18 2 0
36 37 1 0
3 9 2 0
37 38 2 0
38 33 1 0
31 33 1 0
18 19 1 0
36 39 1 0
2 3 1 0
39 40 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.52Molecular Weight (Monoisotopic): 538.1488AlogP: 4.19#Rotatable Bonds: 9Polar Surface Area: 152.78Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.59CX Basic pKa: ┄CX LogP: 3.79CX LogD: 2.95Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -0.54
References 1. Reiter LA, Freeman-Cook KD, Jones CS, Martinelli GJ, Antipas AS, Berliner MA, Datta K, Downs JT, Eskra JD, Forman MD, Greer EM, Guzman R, Hardink JR, Janat F, Keene NF, Laird ER, Liras JL, Lopresti-Morrow LL, Mitchell PG, Pandit J, Robertson D, Sperger D, Vaughn-Bowser ML, Waller DM, Yocum SA.. (2006) Potent, selective pyrimidinetrione-based inhibitors of MMP-13., 16 (22): [PMID:16942871 ] [10.1016/j.bmcl.2006.08.066 ] 2. Georgiadis D, Yiotakis A.. (2008) Specific targeting of metzincin family members with small-molecule inhibitors: progress toward a multifarious challenge., 16 (19): [PMID:18790648 ] [10.1016/j.bmc.2008.08.058 ]