N4,N5-bis(2-methoxyethyl)-3-(phenylsulfonylmethyl)isoxazole-4,5-dicarboxamide

ID: ALA2227700

PubChem CID: 44245456

Max Phase: Preclinical

Molecular Formula: C18H23N3O7S

Molecular Weight: 425.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCNC(=O)c1onc(CS(=O)(=O)c2ccccc2)c1C(=O)NCCOC

Standard InChI:  InChI=1S/C18H23N3O7S/c1-26-10-8-19-17(22)15-14(12-29(24,25)13-6-4-3-5-7-13)21-28-16(15)18(23)20-9-11-27-2/h3-7H,8-12H2,1-2H3,(H,19,22)(H,20,23)

Standard InChI Key:  OBOHNBYTEZZOFC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
   12.6203  -24.8157    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8662  -25.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5330  -25.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9290  -24.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7540  -24.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0108  -23.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3415  -22.9623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6764  -23.4490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4432  -24.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7957  -23.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4080  -23.7480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9684  -22.3883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2380  -24.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9017  -25.6543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0587  -24.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2883  -24.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7774  -23.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4434  -22.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6223  -22.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1361  -23.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4728  -23.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1930  -23.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8053  -24.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5903  -23.7931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3858  -26.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0494  -27.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5335  -27.7436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1971  -28.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2026  -24.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  4  9  1  0
  9  1  1  0
  6 10  1  0
 10 11  1  0
 10 12  2  0
  5 13  1  0
 13 14  1  0
 13 15  2  0
  1 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 14 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 24 29  1  0
M  END

Associated Targets(non-human)

Helicoverpa zea (137 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aedes aegypti (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Spodoptera exigua (540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.46Molecular Weight (Monoisotopic): 425.1257AlogP: 0.40#Rotatable Bonds: 11
Polar Surface Area: 136.83Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.51CX Basic pKa: CX LogP: -0.58CX LogD: -0.59
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.47

References

1. Yu GJ, Iwamoto S, Robins LI, Fettinger JC, Sparks TC, Lorsbach BA, Kurth MJ..  (2009)  3-(Arylthiomethyl)isoxazole-4,5-dicarboxamides: chemoselective nucleophilic chemistry and insecticidal activity.,  57  (16): [PMID:19624156] [10.1021/jf901512t]

Source