The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(2-tert-butyl-2-(3,5-dimethylbenzoyl)-1-(4-ethylbenzoyl)hydrazinylthio)-3-((6-chloropyridin-3-yl)methyl)imidazolidin-2-ylidene)nitramide ID: ALA2228430
PubChem CID: 46182900
Max Phase: Preclinical
Molecular Formula: C31H36ClN7O4S
Molecular Weight: 638.19
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C(=O)N(SN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])N(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)cc1
Standard InChI: InChI=1S/C31H36ClN7O4S/c1-7-23-8-11-25(12-9-23)29(41)38(37(31(4,5)6)28(40)26-17-21(2)16-22(3)18-26)44-36-15-14-35(30(36)34-39(42)43)20-24-10-13-27(32)33-19-24/h8-13,16-19H,7,14-15,20H2,1-6H3/b34-30-
Standard InChI Key: OHQIJPWWPDREHI-BVNFUTIRSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
12.1758 -17.4769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5845 -16.7692 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.5798 -15.9517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2393 -15.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9822 -14.6848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1646 -14.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9166 -15.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0186 -15.7069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1954 -16.5048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9766 -16.7513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5947 -17.0574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3916 -13.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2088 -13.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6132 -14.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4296 -14.6874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8398 -13.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4276 -13.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6125 -13.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6570 -13.9794 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.9106 -17.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7260 -17.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1330 -16.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7256 -16.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9070 -16.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5038 -16.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9501 -16.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3586 -17.4767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3589 -16.0612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9498 -18.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3582 -18.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1326 -18.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5368 -18.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5842 -18.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4014 -18.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1754 -18.8923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8076 -18.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6240 -18.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0336 -18.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6208 -17.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8057 -17.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4958 -15.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5022 -18.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8508 -18.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2601 -18.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
4 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
5 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
27 1 1 0
1 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 34 1 0
24 41 1 0
20 42 1 0
38 43 1 0
43 44 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 638.19Molecular Weight (Monoisotopic): 637.2238AlogP: 6.14#Rotatable Bonds: 8Polar Surface Area: 115.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.81CX LogD: 6.81Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: -0.93
References 1. Shang J, Sun R, Li Y, Huang R, Bi F, Wang Q.. (2010) Synthesis and insecticidal evaluation of N-tert-butyl-N'-thio[1-(6-chloro-3-pyridylmethyl)-2-nitroiminoimidazolidine]-N,N'-diacylhydrazines., 58 (3): [PMID:20041716 ] [10.1021/jf903642s ]