The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(1-benzoyl-2-tert-butyl-2-(3,5-dimethylbenzoyl)hydrazinylthio)-3-((6-chloropyridin-3-yl)methyl)imidazolidin-2-ylidene)nitramide ID: ALA2228431
PubChem CID: 46183140
Max Phase: Preclinical
Molecular Formula: C29H32ClN7O4S
Molecular Weight: 610.14
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)cc(C(=O)N(N(SN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])C(=O)c2ccccc2)C(C)(C)C)c1
Standard InChI: InChI=1S/C29H32ClN7O4S/c1-20-15-21(2)17-24(16-20)26(38)35(29(3,4)5)36(27(39)23-9-7-6-8-10-23)42-34-14-13-33(28(34)32-37(40)41)19-22-11-12-25(30)31-18-22/h6-12,15-18H,13-14,19H2,1-5H3/b32-28-
Standard InChI Key: IKMQVYMONHHZNH-BLCKFSMSSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
21.6725 -17.0146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0813 -16.3070 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.0765 -15.4895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7361 -14.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4790 -14.2226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6614 -14.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4134 -15.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5154 -15.2447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6921 -16.0425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4734 -16.2890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0915 -16.5951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8883 -13.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7055 -13.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1099 -14.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9264 -14.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3366 -13.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9244 -12.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1093 -12.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1538 -13.5171 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.4074 -17.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2228 -17.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6297 -16.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2223 -15.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4038 -15.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0006 -16.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4469 -16.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8553 -17.0144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8557 -15.5990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4466 -17.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8550 -18.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6294 -17.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0336 -18.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0809 -17.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8981 -17.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6722 -18.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3043 -18.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1208 -18.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5303 -17.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1175 -17.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3025 -17.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9925 -14.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9990 -17.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
4 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
5 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
27 1 1 0
1 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 34 1 0
24 41 1 0
20 42 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.14Molecular Weight (Monoisotopic): 609.1925AlogP: 5.58#Rotatable Bonds: 7Polar Surface Area: 115.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.85CX LogD: 5.85Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -0.90
References 1. Shang J, Sun R, Li Y, Huang R, Bi F, Wang Q.. (2010) Synthesis and insecticidal evaluation of N-tert-butyl-N'-thio[1-(6-chloro-3-pyridylmethyl)-2-nitroiminoimidazolidine]-N,N'-diacylhydrazines., 58 (3): [PMID:20041716 ] [10.1021/jf903642s ]