The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-((6-chloropyridin-3-yl)methyl)-3-(1,2-dibenzoyl-2-tert-butylhydrazinylthio)imidazolidin-2-ylidene)nitramide ID: ALA2228434
PubChem CID: 46182899
Max Phase: Preclinical
Molecular Formula: C27H28ClN7O4S
Molecular Weight: 582.09
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)N(C(=O)c1ccccc1)N(SN1CCN(Cc2ccc(Cl)nc2)/C1=N/[N+](=O)[O-])C(=O)c1ccccc1
Standard InChI: InChI=1S/C27H28ClN7O4S/c1-27(2,3)33(24(36)21-10-6-4-7-11-21)34(25(37)22-12-8-5-9-13-22)40-32-17-16-31(26(32)30-35(38)39)19-20-14-15-23(28)29-18-20/h4-15,18H,16-17,19H2,1-3H3/b30-26-
Standard InChI Key: AMFPOMMXRGRGET-BXVZCJGGSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-0.2682 -17.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5553 -17.9395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9623 -17.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5549 -16.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2646 -16.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6703 -17.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7794 -17.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1879 -17.9430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1882 -16.5276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7791 -18.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -19.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9619 -18.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3661 -19.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0051 -17.9432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4135 -18.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2307 -18.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0047 -19.3586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6369 -19.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4533 -19.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8629 -18.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4501 -17.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6350 -17.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4138 -17.2356 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4091 -16.4181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0686 -15.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8115 -15.1512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9939 -15.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7459 -15.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8479 -16.1733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0247 -16.9712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8059 -17.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4240 -17.5237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2209 -14.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0381 -14.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4425 -15.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2589 -15.1537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6691 -14.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2569 -13.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4418 -13.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4863 -14.4458 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
14 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
25 29 2 0
29 30 1 0
30 31 2 0
30 32 1 0
26 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 40 1 0
M CHG 2 30 1 32 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.09Molecular Weight (Monoisotopic): 581.1612AlogP: 4.96#Rotatable Bonds: 7Polar Surface Area: 115.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.82CX LogD: 4.82Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -0.80
References 1. Shang J, Sun R, Li Y, Huang R, Bi F, Wang Q.. (2010) Synthesis and insecticidal evaluation of N-tert-butyl-N'-thio[1-(6-chloro-3-pyridylmethyl)-2-nitroiminoimidazolidine]-N,N'-diacylhydrazines., 58 (3): [PMID:20041716 ] [10.1021/jf903642s ]