The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rel-Squamocin ID: ALA2228644
PubChem CID: 10100453
Max Phase: Preclinical
Molecular Formula: C37H66O7
Molecular Weight: 622.93
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC[C@H](O)CCC[C@@H](O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@H](O)CCCCCCCCCCCCC3=C[C@H](C)OC3=O)O2)O1
Standard InChI: InChI=1S/C37H66O7/c1-3-4-5-15-19-30(38)20-17-22-32(40)34-24-26-36(44-34)35-25-23-33(43-35)31(39)21-16-13-11-9-7-6-8-10-12-14-18-29-27-28(2)42-37(29)41/h27-28,30-36,38-40H,3-26H2,1-2H3/t28-,30-,31+,32+,33+,34+,35+,36+/m0/s1
Standard InChI Key: DAEFUOXKPZLQMM-WGCJABNLSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
10.5392 -14.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3142 -14.9848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8025 -14.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3223 -13.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5454 -13.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6204 -14.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0975 -14.9926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8775 -14.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8822 -13.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1077 -13.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8750 -15.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1313 -14.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9544 -16.0159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4670 -15.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7233 -15.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0590 -15.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3112 -15.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6469 -15.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9032 -15.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2390 -15.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4953 -15.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8310 -15.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5355 -15.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4427 -16.0431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2822 -14.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9403 -15.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6870 -15.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3451 -15.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0959 -15.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7539 -15.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5007 -15.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1587 -15.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9096 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5676 -16.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3144 -15.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9724 -16.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7233 -15.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4254 -16.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0378 -15.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7073 -14.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8961 -15.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1235 -14.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5070 -17.0775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1399 -16.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
3 2 1 6
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 1
8 7 1 6
8 9 1 0
9 10 1 0
10 6 1 0
3 6 1 0
1 11 1 0
11 12 1 0
11 13 1 6
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
8 23 1 0
23 24 1 1
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 37 2 0
40 42 1 6
38 43 2 0
16 44 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 622.93Molecular Weight (Monoisotopic): 622.4809AlogP: 7.86#Rotatable Bonds: 25Polar Surface Area: 105.45Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 8.68CX LogD: 8.68Aromatic Rings: ┄Heavy Atoms: 44QED Weighted: 0.07Np Likeness Score: 1.82
References 1. Dang QL, Kim WK, Nguyen CM, Choi YH, Choi GJ, Jang KS, Park MS, Lim CH, Luu NH, Kim JC.. (2011) Nematicidal and antifungal activities of annonaceous acetogenins from Annona squamosa against various plant pathogens., 59 (20): [PMID:21910504 ] [10.1021/jf203017f ]