The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-chlorophenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic(diethyl phosphoric)anhydride ID: ALA2228704
PubChem CID: 136241465
Max Phase: Preclinical
Molecular Formula: C20H21ClN3O6P
Molecular Weight: 465.83
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)O/C(COc1ccc(Cl)cc1)=N\N=C1/C(=O)Nc2ccccc21
Standard InChI: InChI=1S/C20H21ClN3O6P/c1-3-28-31(26,29-4-2)30-18(13-27-15-11-9-14(21)10-12-15)23-24-19-16-7-5-6-8-17(16)22-20(19)25/h5-12H,3-4,13H2,1-2H3,(H,22,24,25)/b23-18-
Standard InChI Key: SORQJVUKVQLYIY-NKFKGCMQSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.7109 -24.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4205 -24.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4177 -23.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7091 -23.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0028 -24.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0040 -23.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2279 -23.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7469 -23.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2259 -24.5339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9297 -23.8715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9765 -22.4352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1774 -22.2640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9261 -21.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4739 -20.8800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2719 -21.0518 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.8207 -20.4447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5243 -21.8287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1190 -20.2490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6197 -20.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1675 -20.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3233 -21.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8711 -21.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1270 -21.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8757 -20.5378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0766 -20.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8288 -19.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0306 -19.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4819 -20.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7371 -20.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5347 -20.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6826 -19.8552 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
7 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
17 21 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.83Molecular Weight (Monoisotopic): 465.0856AlogP: 4.67#Rotatable Bonds: 9Polar Surface Area: 107.81Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 3.73CX LogD: 3.73Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.25Np Likeness Score: -0.60
References 1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK.. (2008) Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane., 56 (22): [PMID:18954075 ] [10.1021/jf801975z ]