(diethyl phosphoric)-2-(4-nitrophenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic anhydride

ID: ALA2228705

PubChem CID: 136245120

Max Phase: Preclinical

Molecular Formula: C20H21N4O8P

Molecular Weight: 476.38

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)O/C(COc1ccc([N+](=O)[O-])cc1)=N\N=C1/C(=O)Nc2ccccc21

Standard InChI:  InChI=1S/C20H21N4O8P/c1-3-30-33(28,31-4-2)32-18(13-29-15-11-9-14(10-12-15)24(26)27)22-23-19-16-7-5-6-8-17(16)21-20(19)25/h5-12H,3-4,13H2,1-2H3,(H,21,23,25)/b22-18-

Standard InChI Key:  WXVDPCLFFUWHBI-PYCFMQQDSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   25.8733  -25.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5830  -24.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5802  -23.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8715  -23.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1653  -24.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1665  -23.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3903  -23.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9093  -24.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3883  -25.0333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0921  -24.3709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1390  -22.9346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3399  -22.7634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0886  -21.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6363  -21.3794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4344  -21.5512    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   24.9831  -20.9441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6867  -22.3281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2814  -20.7484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7822  -21.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3299  -20.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4858  -22.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0335  -21.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2895  -21.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0382  -21.0371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2391  -20.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9913  -20.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1930  -19.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6444  -20.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8995  -21.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6972  -21.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8451  -20.3546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2953  -20.9595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5899  -19.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  7 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  2  0
 16 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  1  0
 13 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  2  0
 31 33  1  0
M  CHG  2  31   1  33  -1
M  END

Alternative Forms

1. Parent:

   

   ALA2228705

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 476.38

Molecular Weight (Monoisotopic): 476.1097

AlogP: 3.93

#Rotatable Bonds: 10

Polar Surface Area: 150.95

Molecular Species: NEUTRAL

HBA: 10

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 12

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 9.85

CX Basic pKa: ┄

CX LogP: 3.07

CX LogD: 3.07

Aromatic Rings: 2

Heavy Atoms: 33

QED Weighted: 0.18

Np Likeness Score: -0.71

References

1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK..  (2008)  Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane.,  56  (22): [PMID:18954075] [10.1021/jf801975z]

Source

Source(1):

• Scientific Literature