The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(diethyl phosphoric)-2-(4-nitrophenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic anhydride ID: ALA2228705
PubChem CID: 136245120
Max Phase: Preclinical
Molecular Formula: C20H21N4O8P
Molecular Weight: 476.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)O/C(COc1ccc([N+](=O)[O-])cc1)=N\N=C1/C(=O)Nc2ccccc21
Standard InChI: InChI=1S/C20H21N4O8P/c1-3-30-33(28,31-4-2)32-18(13-29-15-11-9-14(10-12-15)24(26)27)22-23-19-16-7-5-6-8-17(16)21-20(19)25/h5-12H,3-4,13H2,1-2H3,(H,21,23,25)/b22-18-
Standard InChI Key: WXVDPCLFFUWHBI-PYCFMQQDSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
25.8733 -25.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5830 -24.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5802 -23.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8715 -23.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1653 -24.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1665 -23.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3903 -23.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9093 -24.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3883 -25.0333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0921 -24.3709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1390 -22.9346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3399 -22.7634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0886 -21.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6363 -21.3794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4344 -21.5512 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
24.9831 -20.9441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6867 -22.3281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2814 -20.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7822 -21.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3299 -20.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4858 -22.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0335 -21.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2895 -21.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0382 -21.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2391 -20.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9913 -20.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1930 -19.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6444 -20.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8995 -21.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6972 -21.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8451 -20.3546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2953 -20.9595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5899 -19.5751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
7 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
17 21 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 2 0
31 33 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.38Molecular Weight (Monoisotopic): 476.1097AlogP: 3.93#Rotatable Bonds: 10Polar Surface Area: 150.95Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 3.07CX LogD: 3.07Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.18Np Likeness Score: -0.71
References 1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK.. (2008) Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane., 56 (22): [PMID:18954075 ] [10.1021/jf801975z ]