The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(O,O-diethyl phosphorothioic)-2-(4-nitrophenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic anhydride ID: ALA2228708
PubChem CID: 136224014
Max Phase: Preclinical
Molecular Formula: C20H21N4O7PS
Molecular Weight: 492.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=S)(OCC)O/C(COc1ccc([N+](=O)[O-])cc1)=N\N=C1/C(=O)Nc2ccccc21
Standard InChI: InChI=1S/C20H21N4O7PS/c1-3-29-32(33,30-4-2)31-18(13-28-15-11-9-14(10-12-15)24(26)27)22-23-19-16-7-5-6-8-17(16)21-20(19)25/h5-12H,3-4,13H2,1-2H3,(H,21,23,25)/b22-18-
Standard InChI Key: WYDSGUXZHZZAPK-PYCFMQQDSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
16.8388 -30.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5485 -29.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5457 -29.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8370 -28.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1308 -29.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1320 -29.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3558 -28.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8748 -29.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3538 -30.1964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0576 -29.5340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1045 -28.0977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3054 -27.9266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0541 -27.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6018 -26.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3999 -26.7143 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.9486 -26.1072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6522 -27.4913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2469 -25.9116 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7477 -26.2784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2954 -25.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4513 -27.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9990 -27.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2550 -26.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0037 -26.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2046 -26.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9568 -25.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1585 -25.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6099 -25.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8650 -26.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6627 -26.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8106 -25.5178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2608 -26.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5554 -24.7383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
7 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
17 21 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 2 0
31 33 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.45Molecular Weight (Monoisotopic): 492.0869AlogP: 4.04#Rotatable Bonds: 10Polar Surface Area: 133.88Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 3.96CX LogD: 3.96Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: -0.74
References 1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK.. (2008) Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane., 56 (22): [PMID:18954075 ] [10.1021/jf801975z ]