The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(diethoxyphosphorothioyloxy)phenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic(O,O-diethyl phosphorothioic)anhydride ID: ALA2228710
PubChem CID: 136264493
Max Phase: Preclinical
Molecular Formula: C24H31N3O8P2S2
Molecular Weight: 615.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=S)(OCC)O/C(COc1ccc(OP(=S)(OCC)OCC)cc1)=N\N=C1/C(=O)Nc2ccccc21
Standard InChI: InChI=1S/C24H31N3O8P2S2/c1-5-30-36(38,31-6-2)34-19-15-13-18(14-16-19)29-17-22(35-37(39,32-7-3)33-8-4)26-27-23-20-11-9-10-12-21(20)25-24(23)28/h9-16H,5-8,17H2,1-4H3,(H,25,27,28)/b26-22-
Standard InChI Key: MCZJUVUDPODKAX-ROMGYVFFSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
14.1525 -6.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4429 -5.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4457 -5.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1543 -4.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8606 -5.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8594 -5.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6356 -4.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1165 -5.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6375 -6.1718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9337 -5.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8869 -4.0731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6860 -3.9020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9373 -3.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3896 -2.5180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5915 -2.6897 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.0428 -2.0826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3392 -3.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7445 -1.8870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.2437 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6959 -1.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5401 -3.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9923 -3.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7364 -2.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9877 -2.1757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7868 -2.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0346 -1.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8328 -1.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3815 -1.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1264 -2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3287 -2.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1808 -1.4932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4332 -0.7160 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
22.2325 -0.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4848 0.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2841 0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8862 -0.1088 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.1186 -1.1609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0760 -1.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7615 -2.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
7 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
17 21 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
32 36 2 0
32 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 615.61Molecular Weight (Monoisotopic): 615.1028AlogP: 5.81#Rotatable Bonds: 15Polar Surface Area: 118.43Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 5.42CX LogD: 5.42Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -0.27
References 1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK.. (2008) Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane., 56 (22): [PMID:18954075 ] [10.1021/jf801975z ]