2-(2-(diethoxyphosphorothioyl)phenoxy)-N'-(2-oxoindolin-3-ylidene)acetohydrazonic(O,O-diethyl phosphorothioic)anhydride

ID: ALA2228712

PubChem CID: 136249227

Max Phase: Preclinical

Molecular Formula: C24H31N3O7P2S2

Molecular Weight: 599.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=S)(OCC)O/C(COc1ccccc1P(=S)(OCC)OCC)=N\N=C1/C(=O)Nc2ccccc21

Standard InChI:  InChI=1S/C24H31N3O7P2S2/c1-5-30-35(37,31-6-2)21-16-12-11-15-20(21)29-17-22(34-36(38,32-7-3)33-8-4)26-27-23-18-13-9-10-14-19(18)25-24(23)28/h9-16H,5-8,17H2,1-4H3,(H,25,27,28)/b26-22-

Standard InChI Key:  JXGUITLOLYCVEB-ROMGYVFFSA-N

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   12.7575  -14.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0479  -14.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0507  -13.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7593  -13.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4656  -14.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4644  -13.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2406  -13.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7215  -14.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2425  -14.7028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5387  -14.0404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4919  -12.6041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2910  -12.4330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5423  -11.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9946  -11.0489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1965  -11.2207    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.6478  -10.6136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9442  -11.9977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3494  -10.4180    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8487  -10.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3009  -10.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1451  -12.1688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5973  -11.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3414  -11.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5927  -10.7067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3918  -10.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6396   -9.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4378   -9.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9865  -10.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7314  -10.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9337  -11.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0906   -9.1535    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   16.2919   -9.3263    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8173   -8.7798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5043   -9.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2311   -8.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4672   -8.6250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6132   -7.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9899   -7.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  7 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  2  0
 16 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  1  0
 13 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 26 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 31 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2228712

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 599.61

Molecular Weight (Monoisotopic): 599.1079

AlogP: 5.14

#Rotatable Bonds: 14

Polar Surface Area: 109.20

Molecular Species: NEUTRAL

HBA: 11

HBD: 1

#RO5 Violations: 3

HBA (Lipinski): 10

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 9.85

CX Basic pKa: ┄

CX LogP: 5.11

CX LogD: 5.11

Aromatic Rings: 2

Heavy Atoms: 38

QED Weighted: 0.14

Np Likeness Score: -0.30

References

1. Pandey VK, Dwivedi A, Pandey OP, Sengupta SK..  (2008)  Organophosphorus derivatives containing isatin-3-hydrazones as chemotherapeutants against fungal pathogens of sugarcane.,  56  (22): [PMID:18954075] [10.1021/jf801975z]

Source

Source(1):

• Scientific Literature