The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-O-malonyl Macrolactin A ID: ALA2229103
PubChem CID: 71479384
Max Phase: Preclinical
Molecular Formula: C27H36O8
Molecular Weight: 488.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CCC/C=C/C=C/[C@H](O)C[C@@H](O)C/C=C\C=C\[C@@H](OC(=O)CC(=O)O)C/C=C/C=C\C(=O)O1
Standard InChI: InChI=1S/C27H36O8/c1-21-13-7-3-2-4-8-14-22(28)19-23(29)15-9-5-10-16-24(35-27(33)20-25(30)31)17-11-6-12-18-26(32)34-21/h2,4-6,8-12,14,16,18,21-24,28-29H,3,7,13,15,17,19-20H2,1H3,(H,30,31)/b4-2+,9-5-,11-6+,14-8+,16-10+,18-12-/t21-,22+,23+,24-/m1/s1
Standard InChI Key: ZJSLOGHFCRASLO-BFRQYJOGSA-N
Molfile:
RDKit 2D
35 35 0 0 0 0 0 0 0 0999 V2000
12.0350 -18.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0350 -18.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7403 -17.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4456 -18.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1488 -17.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8577 -18.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5569 -17.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2654 -18.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -18.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9613 -17.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6699 -18.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3657 -20.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3681 -19.3733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6667 -20.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9614 -21.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6643 -21.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7405 -19.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7382 -20.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4442 -20.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4442 -21.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1446 -21.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8500 -21.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5483 -21.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2493 -21.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0292 -20.6183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7359 -21.8368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0726 -20.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9640 -19.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1467 -16.9515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8533 -16.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8511 -15.7238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5621 -16.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2687 -16.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9775 -16.9440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2665 -15.7201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
2 17 1 0
4 3 2 0
4 5 1 0
6 5 1 0
6 7 1 0
8 7 2 0
8 10 1 0
11 9 1 0
9 10 2 0
11 13 1 0
14 12 1 0
12 13 1 6
14 16 1 0
24 15 1 0
15 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
18 25 1 1
20 26 1 6
12 27 1 0
11 28 2 0
5 29 1 1
29 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.58Molecular Weight (Monoisotopic): 488.2410AlogP: 3.72#Rotatable Bonds: 3Polar Surface Area: 130.36Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.19CX Basic pKa: ┄CX LogP: 3.85CX LogD: 0.80Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 2.37
References 1. Yuan J, Li B, Zhang N, Waseem R, Shen Q, Huang Q.. (2012) Production of bacillomycin- and macrolactin-type antibiotics by Bacillus amyloliquefaciens NJN-6 for suppressing soilborne plant pathogens., 60 (12): [PMID:22385216 ] [10.1021/jf204868z ]