7-O-malonyl Macrolactin A

ID: ALA2229103

PubChem CID: 71479384

Max Phase: Preclinical

Molecular Formula: C27H36O8

Molecular Weight: 488.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CCC/C=C/C=C/[C@H](O)C[C@@H](O)C/C=C\C=C\[C@@H](OC(=O)CC(=O)O)C/C=C/C=C\C(=O)O1

Standard InChI:  InChI=1S/C27H36O8/c1-21-13-7-3-2-4-8-14-22(28)19-23(29)15-9-5-10-16-24(35-27(33)20-25(30)31)17-11-6-12-18-26(32)34-21/h2,4-6,8-12,14,16,18,21-24,28-29H,3,7,13,15,17,19-20H2,1H3,(H,30,31)/b4-2+,9-5-,11-6+,14-8+,16-10+,18-12-/t21-,22+,23+,24-/m1/s1

Standard InChI Key:  ZJSLOGHFCRASLO-BFRQYJOGSA-N

Molfile:  

     RDKit          2D

 35 35  0  0  0  0  0  0  0  0999 V2000
   12.0350  -18.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0350  -18.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7403  -17.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4456  -18.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1488  -17.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8577  -18.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5569  -17.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2654  -18.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6658  -18.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9613  -17.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6699  -18.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3657  -20.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3681  -19.3733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6667  -20.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9614  -21.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6643  -21.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7405  -19.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7382  -20.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4442  -20.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4442  -21.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1446  -21.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8500  -21.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5483  -21.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2493  -21.4255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0292  -20.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7359  -21.8368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0726  -20.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9640  -19.3855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1467  -16.9515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8533  -16.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8511  -15.7238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5621  -16.9477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2687  -16.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9775  -16.9440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2665  -15.7201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  2 17  1  0
  4  3  2  0
  4  5  1  0
  6  5  1  0
  6  7  1  0
  8  7  2  0
  8 10  1  0
 11  9  1  0
  9 10  2  0
 11 13  1  0
 14 12  1  0
 12 13  1  6
 14 16  1  0
 24 15  1  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 18 25  1  1
 20 26  1  6
 12 27  1  0
 11 28  2  0
  5 29  1  1
 29 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Ralstonia solanacearum (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.58Molecular Weight (Monoisotopic): 488.2410AlogP: 3.72#Rotatable Bonds: 3
Polar Surface Area: 130.36Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.19CX Basic pKa: CX LogP: 3.85CX LogD: 0.80
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 2.37

References

1. Yuan J, Li B, Zhang N, Waseem R, Shen Q, Huang Q..  (2012)  Production of bacillomycin- and macrolactin-type antibiotics by Bacillus amyloliquefaciens NJN-6 for suppressing soilborne plant pathogens.,  60  (12): [PMID:22385216] [10.1021/jf204868z]

Source