The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Carabryl 2,3-Dimethoxybenzoate ID: ALA2229152
PubChem CID: 76333212
Max Phase: Preclinical
Molecular Formula: C24H30O6
Molecular Weight: 414.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2C[C@]3(C)C(CCC(C)OC(=O)c4cccc(OC)c4OC)[C@@H]3C[C@H]12
Standard InChI: InChI=1S/C24H30O6/c1-13(29-23(26)15-7-6-8-19(27-4)21(15)28-5)9-10-17-18-11-16-14(2)22(25)30-20(16)12-24(17,18)3/h6-8,13,16-18,20H,2,9-12H2,1,3-5H3/t13?,16-,17?,18+,20-,24-/m1/s1
Standard InChI Key: HXLYLVZWNGILLL-CANVIVFDSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
40.3873 -20.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3873 -19.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0993 -19.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1038 -20.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8864 -20.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3657 -20.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8791 -19.4004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6753 -20.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6753 -19.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9608 -20.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1358 -20.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7233 -19.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8983 -19.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4858 -18.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4858 -20.0710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2585 -18.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1457 -21.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1907 -20.0577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6608 -20.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2482 -20.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2482 -19.3565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4241 -20.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0117 -21.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4242 -22.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2535 -22.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6623 -21.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0140 -20.0646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1889 -20.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1867 -21.4937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7745 -20.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 2 1 0
8 1 1 1
4 1 1 1
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
9 8 1 0
10 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
9 16 1 6
5 17 2 0
6 18 2 0
15 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
22 27 1 0
27 28 1 0
23 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.50Molecular Weight (Monoisotopic): 414.2042AlogP: 4.17#Rotatable Bonds: 7Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.42CX LogD: 4.42Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: 1.86
References 1. Feng JT, Wang H, Ren SX, He J, Liu Y, Zhang X.. (2012) Synthesis and antifungal activities of carabrol ester derivatives., 60 (15): [PMID:22443262 ] [10.1021/jf205123d ]