Carabryl 3,4-Dimethoxybenzoate

ID: ALA2229153

PubChem CID: 76329550

Max Phase: Preclinical

Molecular Formula: C24H30O6

Molecular Weight: 414.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@@H]2C[C@]3(C)C(CCC(C)OC(=O)c4ccc(OC)c(OC)c4)[C@@H]3C[C@H]12

Standard InChI:  InChI=1S/C24H30O6/c1-13(29-23(26)15-7-9-19(27-4)20(10-15)28-5)6-8-17-18-11-16-14(2)22(25)30-21(16)12-24(17,18)3/h7,9-10,13,16-18,21H,2,6,8,11-12H2,1,3-5H3/t13?,16-,17?,18+,21-,24-/m1/s1

Standard InChI Key:  VAXWJPHMTYOWLE-DSOYSXOZSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.1454  -25.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1454  -24.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8574  -24.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8620  -25.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6446  -25.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1238  -25.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6373  -24.3421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4333  -25.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4333  -24.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7189  -25.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8939  -25.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4813  -24.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6564  -24.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2439  -23.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2439  -25.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167  -23.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9037  -26.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9488  -24.9994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4189  -25.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0064  -25.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0064  -24.2981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1823  -25.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7698  -26.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824  -27.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0117  -27.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4203  -26.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0615  -26.4354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4744  -25.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7708  -27.8662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0542  -27.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9  2  1  0
  8  1  1  1
  4  1  1  1
  3  2  1  1
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  9  8  1  0
 10  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
  9 16  1  6
  5 17  2  0
  6 18  2  0
 15 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 23 27  1  0
 27 28  1  0
 24 29  1  0
 29 30  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Colletotrichum lagenaria (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.50Molecular Weight (Monoisotopic): 414.2042AlogP: 4.17#Rotatable Bonds: 7
Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.42CX LogD: 4.42
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: 1.90

References

1. Feng JT, Wang H, Ren SX, He J, Liu Y, Zhang X..  (2012)  Synthesis and antifungal activities of carabrol ester derivatives.,  60  (15): [PMID:22443262] [10.1021/jf205123d]

Source