The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Carabryl 2-Ethoxybenzoate ID: ALA2229154
PubChem CID: 76333213
Max Phase: Preclinical
Molecular Formula: C24H30O5
Molecular Weight: 398.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2C[C@]3(C)C(CCC(C)OC(=O)c4ccccc4OCC)[C@@H]3C[C@H]12
Standard InChI: InChI=1S/C24H30O5/c1-5-27-20-9-7-6-8-16(20)23(26)28-14(2)10-11-18-19-12-17-15(3)22(25)29-21(17)13-24(18,19)4/h6-9,14,17-19,21H,3,5,10-13H2,1-2,4H3/t14?,17-,18?,19+,21-,24-/m1/s1
Standard InChI Key: QYGSTIIGVYHDNH-CBCUOUHFSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
17.0372 -25.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0372 -24.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7491 -24.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7537 -25.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5363 -25.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0155 -25.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5290 -24.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3251 -25.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3251 -24.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6107 -25.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7856 -25.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3731 -24.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5481 -24.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1356 -23.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1356 -25.1543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9085 -24.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7955 -26.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8405 -25.1410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3106 -25.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8981 -25.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8981 -24.4399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0740 -25.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6616 -26.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0741 -27.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9034 -27.2903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3121 -26.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6638 -25.1480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0786 -24.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6684 -23.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 2 1 0
8 1 1 1
4 1 1 1
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
9 8 1 0
10 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
9 16 1 6
5 17 2 0
6 18 2 0
15 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
22 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.50Molecular Weight (Monoisotopic): 398.2093AlogP: 4.55#Rotatable Bonds: 7Polar Surface Area: 61.83Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: 1.62
References 1. Feng JT, Wang H, Ren SX, He J, Liu Y, Zhang X.. (2012) Synthesis and antifungal activities of carabrol ester derivatives., 60 (15): [PMID:22443262 ] [10.1021/jf205123d ]