The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Carabryl 3-(4-Nitrophenyl)acrylate ID: ALA2229159
PubChem CID: 76325972
Max Phase: Preclinical
Molecular Formula: C24H27NO6
Molecular Weight: 425.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2C[C@]3(C)C(CCC(C)OC(=O)/C=C/c4ccc([N+](=O)[O-])cc4)[C@@H]3C[C@H]12
Standard InChI: InChI=1S/C24H27NO6/c1-14(30-22(26)11-7-16-5-8-17(9-6-16)25(28)29)4-10-19-20-12-18-15(2)23(27)31-21(18)13-24(19,20)3/h5-9,11,14,18-21H,2,4,10,12-13H2,1,3H3/b11-7+/t14?,18-,19?,20+,21-,24-/m1/s1
Standard InChI Key: WFVCGIOQUSAHNZ-YAQJHVPJSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
40.8547 -28.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8547 -27.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5667 -27.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5712 -28.2971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3539 -28.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8331 -27.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3465 -27.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1426 -28.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1426 -27.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4281 -27.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6031 -27.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1906 -27.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3656 -27.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9530 -26.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9530 -27.8881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7260 -26.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6131 -29.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6582 -27.8749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1280 -27.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7156 -28.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7156 -27.1737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8914 -28.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4790 -29.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6560 -29.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2436 -30.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6555 -30.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4840 -30.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8926 -30.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2432 -31.4577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6564 -32.1719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4182 -31.4584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9 2 1 0
8 1 1 1
4 1 1 1
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
9 8 1 0
10 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
9 16 1 6
5 17 2 0
6 18 2 0
15 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 2 0
29 31 1 0
26 29 1 0
M CHG 2 29 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.48Molecular Weight (Monoisotopic): 425.1838AlogP: 4.46#Rotatable Bonds: 7Polar Surface Area: 95.74Molecular Species: ┄HBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.21CX LogD: 5.21Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: 1.78
References 1. Feng JT, Wang H, Ren SX, He J, Liu Y, Zhang X.. (2012) Synthesis and antifungal activities of carabrol ester derivatives., 60 (15): [PMID:22443262 ] [10.1021/jf205123d ]