The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-ethoxyethyl 2-cyano-4-methyl-3-((3-(4-(trifluoromethyl)phenyl)-1,2,4-oxadiazol-5-yl)methylamino)pent-2-enoate ID: ALA2229423
PubChem CID: 42604297
Max Phase: Preclinical
Molecular Formula: C21H23F3N4O4
Molecular Weight: 452.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOCCOC(=O)/C(C#N)=C(\NCc1nc(-c2ccc(C(F)(F)F)cc2)no1)C(C)C
Standard InChI: InChI=1S/C21H23F3N4O4/c1-4-30-9-10-31-20(29)16(11-25)18(13(2)3)26-12-17-27-19(28-32-17)14-5-7-15(8-6-14)21(22,23)24/h5-8,13,26H,4,9-10,12H2,1-3H3/b18-16-
Standard InChI Key: OYVAGNCHSYGEAP-VLGSPTGOSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
6.7356 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5528 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9614 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9614 -16.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7786 -16.8495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5528 -16.1418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1872 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0044 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4130 -16.8495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2302 -16.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6388 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3719 -18.9716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3270 -16.8495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5097 -16.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1467 -16.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5270 -15.3893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9555 -14.8052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2233 -15.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3424 -15.9766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4960 -14.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4635 -13.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7403 -13.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0491 -14.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0858 -14.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8094 -15.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3246 -13.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2897 -12.8375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.6350 -14.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.6108 -13.2443 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3270 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5099 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7356 -18.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
2 4 1 0
4 5 1 0
4 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
3 12 3 0
1 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 2 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
18 20 1 0
23 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
1 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.43Molecular Weight (Monoisotopic): 452.1671AlogP: 3.86#Rotatable Bonds: 10Polar Surface Area: 110.27Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.05CX LogD: 4.05Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -1.72
References 1. Zhao Q, Liu S, Li Y, Wang Q.. (2009) Design, synthesis, and biological activities of novel 2-cyanoacrylates containing oxazole, oxadiazole, or quinoline moieties., 57 (7): [PMID:19271709 ] [10.1021/jf803632t ]