2-ethoxyethyl 2-cyano-4-methyl-3-((3-(4-(trifluoromethyl)phenyl)-1,2,4-oxadiazol-5-yl)methylamino)pent-2-enoate

ID: ALA2229423

PubChem CID: 42604297

Max Phase: Preclinical

Molecular Formula: C21H23F3N4O4

Molecular Weight: 452.43

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOCCOC(=O)/C(C#N)=C(\NCc1nc(-c2ccc(C(F)(F)F)cc2)no1)C(C)C

Standard InChI:  InChI=1S/C21H23F3N4O4/c1-4-30-9-10-31-20(29)16(11-25)18(13(2)3)26-12-17-27-19(28-32-17)14-5-7-15(8-6-14)21(22,23)24/h5-8,13,26H,4,9-10,12H2,1-3H3/b18-16-

Standard InChI Key:  OYVAGNCHSYGEAP-VLGSPTGOSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    6.7356  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5528  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9614  -18.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9614  -16.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7786  -16.8495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5528  -16.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1872  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0044  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4130  -16.8495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2302  -16.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6388  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3719  -18.9716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3270  -16.8495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5097  -16.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1467  -16.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5270  -15.3893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9555  -14.8052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2233  -15.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3424  -15.9766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4960  -14.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4635  -13.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7403  -13.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0491  -14.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0858  -14.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8094  -15.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3246  -13.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2897  -12.8375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6350  -14.0924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6108  -13.2443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3270  -18.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5099  -18.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7356  -18.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  4  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  3 12  3  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 18 20  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  1 30  1  0
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2229423

   2-ethoxyethyl (Z)-2-cyano-4-methyl-3-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylamino]pent-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 452.43

Molecular Weight (Monoisotopic): 452.1671

AlogP: 3.86

#Rotatable Bonds: 10

Polar Surface Area: 110.27

Molecular Species: NEUTRAL

HBA: 8

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.05

CX LogD: 4.05

Aromatic Rings: 2

Heavy Atoms: 32

QED Weighted: 0.25

Np Likeness Score: -1.72

References

1. Zhao Q, Liu S, Li Y, Wang Q..  (2009)  Design, synthesis, and biological activities of novel 2-cyanoacrylates containing oxazole, oxadiazole, or quinoline moieties.,  57  (7): [PMID:19271709] [10.1021/jf803632t]

Source

Source(1):

• Scientific Literature