The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(2,6-Difluorobenzoyl)-N-(morpholinothio)-N-(4-(trifluoromethoxy)phenyl)urea ID: ALA2229553
PubChem CID: 42630877
Max Phase: Preclinical
Molecular Formula: C19H16F5N3O4S
Molecular Weight: 477.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(=O)N(SN1CCOCC1)c1ccc(OC(F)(F)F)cc1)c1c(F)cccc1F
Standard InChI: InChI=1S/C19H16F5N3O4S/c20-14-2-1-3-15(21)16(14)17(28)25-18(29)27(32-26-8-10-30-11-9-26)12-4-6-13(7-5-12)31-19(22,23)24/h1-7H,8-11H2,(H,25,28,29)
Standard InChI Key: NHIUFYVZXJUKNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
6.1772 -10.9426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7647 -11.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1772 -12.3716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -11.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7647 -10.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -10.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5272 -9.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -8.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7647 -8.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1772 -9.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5272 -8.0848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -7.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3522 -6.6558 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7651 -7.4501 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3916 -6.6251 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0022 -10.9426 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.2397 -8.7992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6522 -9.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2397 -10.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4147 -10.2282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0022 -9.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4147 -8.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5272 -12.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7022 -12.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2897 -13.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4647 -13.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0522 -12.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4647 -11.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2897 -11.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -13.0861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7022 -10.9426 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7022 -13.8005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
11 12 1 0
12 13 1 0
12 14 1 0
12 15 1 0
8 11 1 0
1 5 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
16 20 1 0
1 16 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
23 30 2 0
29 31 1 0
25 32 1 0
4 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.41Molecular Weight (Monoisotopic): 477.0782AlogP: 4.12#Rotatable Bonds: 5Polar Surface Area: 71.11Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.10CX Basic pKa: 0.54CX LogP: 4.32CX LogD: 4.24Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.29
References 1. Sun R, Zhang Y, Chen L, Li Y, Li Q, Song H, Huang R, Bi F, Wang Q.. (2009) Design, synthesis, and insecticidal activities of new N-benzoyl-N'-phenyl-N'-sulfenylureas., 57 (9): [PMID:19326865 ] [10.1021/jf900324a ]