N5-benzyl-3-((4-chlorophenylsulfonyl)methyl)-N4-propylisoxazole-4,5-dicarboxamide

ID: ALA2229744

PubChem CID: 44245978

Max Phase: Preclinical

Molecular Formula: C22H22ClN3O5S

Molecular Weight: 475.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCNC(=O)c1c(CS(=O)(=O)c2ccc(Cl)cc2)noc1C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C22H22ClN3O5S/c1-2-12-24-21(27)19-18(14-32(29,30)17-10-8-16(23)9-11-17)26-31-20(19)22(28)25-13-15-6-4-3-5-7-15/h3-11H,2,12-14H2,1H3,(H,24,27)(H,25,28)

Standard InChI Key:  JJDVJGSVJPWTRL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   12.7150  -25.0177    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8023  -24.1972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0481  -24.5319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0212  -24.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8462  -24.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1030  -23.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4337  -23.1673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7686  -23.6540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5354  -25.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3303  -25.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9939  -25.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1510  -25.0209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8880  -23.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5003  -23.9530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0606  -22.5934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2853  -23.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8977  -24.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7211  -25.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3326  -25.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1185  -25.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2895  -24.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6767  -23.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6351  -25.6889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2292  -25.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4081  -25.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9225  -26.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2569  -27.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0819  -27.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5638  -26.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2987  -26.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7720  -27.6875    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.7828  -27.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  4  9  1  0
  9  1  1  0
  5 10  1  0
 10 11  2  0
 10 12  1  0
  6 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 23  1  0
  1 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 23 30  1  0
 27 31  1  0
 30 32  1  0
M  END

Associated Targets(non-human)

Helicoverpa zea (137 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aedes aegypti (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Spodoptera exigua (540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.95Molecular Weight (Monoisotopic): 475.0969AlogP: 3.37#Rotatable Bonds: 9
Polar Surface Area: 118.37Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.53CX Basic pKa: CX LogP: 2.72CX LogD: 2.72
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -1.69

References

1. Yu GJ, Iwamoto S, Robins LI, Fettinger JC, Sparks TC, Lorsbach BA, Kurth MJ..  (2009)  3-(Arylthiomethyl)isoxazole-4,5-dicarboxamides: chemoselective nucleophilic chemistry and insecticidal activity.,  57  (16): [PMID:19624156] [10.1021/jf901512t]

Source