The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N5-benzyl-N4-butyl-3-((4-chlorophenylsulfonyl)methyl)isoxazole-4,5-dicarboxamide ID: ALA2229745
PubChem CID: 44245981
Max Phase: Preclinical
Molecular Formula: C23H24ClN3O5S
Molecular Weight: 489.98
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)c1c(CS(=O)(=O)c2ccc(Cl)cc2)noc1C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C23H24ClN3O5S/c1-2-3-13-25-22(28)20-19(15-33(30,31)18-11-9-17(24)10-12-18)27-32-21(20)23(29)26-14-16-7-5-4-6-8-16/h4-12H,2-3,13-15H2,1H3,(H,25,28)(H,26,29)
Standard InChI Key: LYSVUBQALCIXFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
21.1147 -25.4212 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.2020 -24.6009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4479 -24.9354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4208 -24.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2458 -24.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5026 -24.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8333 -23.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1682 -24.0576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9350 -25.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7299 -25.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3935 -26.2630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5506 -25.4245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2876 -23.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8999 -24.3566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4602 -22.9970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6849 -24.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2972 -24.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1205 -25.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7321 -26.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5181 -25.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6890 -24.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0761 -24.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0347 -26.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6289 -26.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8078 -26.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3221 -26.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6567 -27.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4816 -27.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9635 -26.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6983 -26.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1824 -27.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8460 -28.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1718 -28.0909 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 4 2 0
4 9 1 0
9 1 1 0
5 10 1 0
10 11 2 0
10 12 1 0
6 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
12 23 1 0
1 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 1 0
30 31 1 0
31 32 1 0
27 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.98Molecular Weight (Monoisotopic): 489.1125AlogP: 3.76#Rotatable Bonds: 10Polar Surface Area: 118.37Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.53CX Basic pKa: ┄CX LogP: 3.16CX LogD: 3.16Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.58
References 1. Yu GJ, Iwamoto S, Robins LI, Fettinger JC, Sparks TC, Lorsbach BA, Kurth MJ.. (2009) 3-(Arylthiomethyl)isoxazole-4,5-dicarboxamides: chemoselective nucleophilic chemistry and insecticidal activity., 57 (16): [PMID:19624156 ] [10.1021/jf901512t ]