N,N'-Bis(3-nitrobenzylidene)propane-1,3-diamine

ID: ALA2230061

PubChem CID: 44248529

Max Phase: Preclinical

Molecular Formula: C17H16N4O4

Molecular Weight: 340.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cccc(/C=N/CCC/N=C/c2cccc([N+](=O)[O-])c2)c1

Standard InChI:  InChI=1S/C17H16N4O4/c22-20(23)16-6-1-4-14(10-16)12-18-8-3-9-19-13-15-5-2-7-17(11-15)21(24)25/h1-2,4-7,10-13H,3,8-9H2/b18-12+,19-13+

Standard InChI Key:  BNRJDAHWNVAPAO-KLCVKJMQSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   26.4756  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7624  -23.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0533  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1847  -23.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3401  -23.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6310  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9178  -23.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2046  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4955  -23.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4955  -22.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2046  -22.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9178  -22.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7864  -23.8760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7864  -24.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0732  -23.4674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8979  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6070  -23.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6070  -22.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3202  -22.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0334  -22.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0334  -23.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3202  -23.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3202  -21.4162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6070  -21.0076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0334  -21.0076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
 13 14  2  0
 13 15  1  0
  9 13  1  0
  5  6  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 23 24  2  0
 23 25  1  0
 19 23  1  0
  4 16  2  0
M  CHG  4  13   1  15  -1  23   1  25  -1
M  END

Alternative Forms

Associated Targets(non-human)

Macrophomina phaseolina (474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Athelia rolfsii (768 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.34Molecular Weight (Monoisotopic): 340.1172AlogP: 3.43#Rotatable Bonds: 8
Polar Surface Area: 111.00Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.14CX LogP: 3.61CX LogD: 3.59
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.32Np Likeness Score: -0.83

References

1. Aggarwal N, Kumar R, Dureja P, Rawat DS..  (2009)  Schiff bases as potential fungicides and nitrification inhibitors.,  57  (18): [PMID:19702271] [10.1021/jf902035w]

Source