The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
lissoclibadin 2 ID: ALA223012
PubChem CID: 11657934
Max Phase: Preclinical
Molecular Formula: C26H38N2O4S5
Molecular Weight: 602.94
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Lissoclibadin 2 | lissoclibadin 2|CHEBI:66580|CHEMBL223012|Q27135195|2,2'-[3,4,9,10-tetramethoxy-2,8-bis(methylsulfanyl)dibenzo[c,f][1,2,5]trithiepine-1,7-diyl]bis(N,N-dimethylethanamine)|2-[4-[2-(dimethylamino)ethyl]-1,2,7,8-tetramethoxy-3,9-bis(methylsulfanyl)benzo[c][1,2,5]benzotrithiepin-10-yl]-N,N-dimethylethanamine
Canonical SMILES: COc1c(SC)c(CCN(C)C)c2sc3c(OC)c(OC)c(SC)c(CCN(C)C)c3ssc2c1OC
Standard InChI: InChI=1S/C26H38N2O4S5/c1-27(2)13-11-15-21(33-9)18(30-6)20(32-8)26-23(15)35-25-19(31-7)17(29-5)22(34-10)16(12-14-28(3)4)24(25)36-37-26/h11-14H2,1-10H3
Standard InChI Key: MGWYCLOYGLKCFF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
11.9689 0.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9678 -0.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7056 -0.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7038 1.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4462 0.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4473 -0.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0843 -0.5475 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.1038 1.3073 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.9017 1.0974 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.2485 0.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8822 -0.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3053 -1.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0987 -1.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4631 -0.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0379 0.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7013 2.0777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2315 1.2215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4900 0.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7083 -1.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9722 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9748 -2.6185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2388 -3.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7136 -3.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9406 -1.7580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5280 -1.6912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1638 -2.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3998 1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9711 1.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3331 2.4188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9044 3.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1236 2.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2595 -0.2729 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6918 -0.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3679 -2.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4375 2.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2301 -0.4837 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4889 -0.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 8 1 0
17 18 1 0
9 10 1 0
3 19 1 0
11 7 1 0
19 20 1 0
8 9 1 0
20 21 1 0
4 1 1 0
21 22 1 0
21 23 1 0
10 11 2 0
12 24 1 0
2 3 1 0
13 25 1 0
11 12 1 0
25 26 1 0
3 6 2 0
15 27 1 0
12 13 2 0
27 28 1 0
1 2 2 0
28 29 1 0
13 14 1 0
29 30 1 0
5 4 2 0
29 31 1 0
14 15 2 0
14 32 1 0
15 10 1 0
32 33 1 0
5 6 1 0
24 34 1 0
4 16 1 0
16 35 1 0
6 7 1 0
2 36 1 0
1 17 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.94Molecular Weight (Monoisotopic): 602.1435AlogP: 6.99#Rotatable Bonds: 12Polar Surface Area: 43.40Molecular Species: BASEHBA: 11HBD: ┄#RO5 Violations: 3HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.33CX LogP: 5.45CX LogD: 2.18Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 0.46
References 1. Nakazawa T, Xu J, Nishikawa T, Oda T, Fujita A, Ukai K, Mangindaan RE, Rotinsulu H, Kobayashi H, Namikoshi M.. (2007) Lissoclibadins 4-7, polysulfur aromatic alkaloids from the Indonesian ascidian Lissoclinum cf. badium., 70 (3): [PMID:17269824 ] [10.1021/np060593c ] 2. Davison EK, Sperry J.. (2017) Natural Products with Heteroatom-Rich Ring Systems., 80 (11): [PMID:29135244 ] [10.1021/acs.jnatprod.7b00575 ]