The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sarcolobine ID: ALA2230141
PubChem CID: 76318737
Max Phase: Preclinical
Molecular Formula: C23H22O7
Molecular Weight: 410.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)[C@]1(O)C(=O)c3ccc4c(c3O[C@@H]1CO2)C1C(O4)C1(C)C
Standard InChI: InChI=1S/C23H22O7/c1-22(2)18-17-12(29-21(18)22)6-5-10-19(17)30-16-9-28-13-8-15(27-4)14(26-3)7-11(13)23(16,25)20(10)24/h5-8,16,18,21,25H,9H2,1-4H3/t16-,18?,21?,23-/m1/s1
Standard InChI Key: HJDODWXISWRQIF-RNPWIZMZSA-N
Molfile:
RDKit 2D
30 35 0 0 0 0 0 0 0 0999 V2000
32.2730 -0.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6876 -0.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0981 -0.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4861 -3.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1974 -4.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9076 -2.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9064 -3.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6199 -4.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6222 -2.5329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6176 -5.0121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3402 -2.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3372 -3.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7763 -2.9560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0575 -2.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7733 -3.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0483 -4.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0420 -5.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7591 -5.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4840 -5.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4921 -4.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1916 -5.4566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1844 -6.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7516 -6.2722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0370 -6.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3291 -4.6027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4824 -2.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1948 -2.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8718 -2.3992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2068 -1.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0236 -1.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
26 4 1 0
4 5 2 0
5 7 1 0
6 27 1 0
6 7 2 0
6 9 1 0
7 8 1 0
8 12 1 0
11 9 1 6
8 10 2 0
11 12 1 0
11 14 1 0
12 16 1 0
15 13 1 0
13 14 1 0
15 16 2 0
15 20 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
12 25 1 1
26 27 2 0
27 30 1 0
29 28 1 0
28 26 1 0
30 29 1 0
2 30 1 0
29 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.42Molecular Weight (Monoisotopic): 410.1366AlogP: 2.81#Rotatable Bonds: 2Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.07CX Basic pKa: ┄CX LogP: 2.39CX LogD: 2.39Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.82Np Likeness Score: 2.35
References 1. Belmain SR, Amoah BA, Nyirenda SP, Kamanula JF, Stevenson PC.. (2012) Highly variable insect control efficacy of Tephrosia vogelii chemotypes., 60 (40): [PMID:22970736 ] [10.1021/jf3032217 ]