nexaver

ID: ALA223415

PubChem CID: 44420332

Max Phase: Preclinical

Molecular Formula: C22H17ClF3N3O3

Molecular Weight: 463.84

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Nexaver | nexaver|CHEMBL223415|SCHEMBL13004783|KDXIWQNPXCUIRU-UHFFFAOYSA-N

Canonical SMILES:  CCC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1

Standard InChI:  InChI=1S/C22H17ClF3N3O3/c1-2-20(30)19-12-16(9-10-27-19)32-15-6-3-13(4-7-15)28-21(31)29-14-5-8-18(23)17(11-14)22(24,25)26/h3-12H,2H2,1H3,(H2,28,29,31)

Standard InChI Key:  KDXIWQNPXCUIRU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   14.0152  -23.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0141  -23.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7289  -24.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4453  -23.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4425  -23.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7271  -22.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2993  -24.3434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5851  -23.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8703  -24.3423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5858  -23.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1562  -23.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1617  -23.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4484  -22.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7326  -23.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7346  -23.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4485  -24.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0179  -22.6901    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.4494  -21.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4417  -21.0375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.2744  -21.8619    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.6244  -21.8714    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.1554  -22.6853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1523  -21.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8670  -21.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8642  -20.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1476  -20.2151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4324  -20.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4386  -21.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7149  -20.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0035  -20.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2860  -20.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7089  -19.4025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
 16 11  1  0
  7  8  1  0
 14 17  1  0
 13 18  1  0
  8  9  1  0
 18 19  1  0
  4  5  1  0
 18 20  1  0
  8 10  2  0
 18 21  1  0
  2  3  1  0
  5 22  1  0
  9 11  1  0
 22 23  1  0
  5  6  2  0
 23 24  2  0
 11 12  2  0
 24 25  1  0
  6  1  1  0
 25 26  2  0
 12 13  1  0
 26 27  1  0
  1  2  2  0
 27 28  2  0
 28 23  1  0
 13 14  2  0
 27 29  1  0
  2  7  1  0
 29 30  1  0
 14 15  1  0
 30 31  1  0
  3  4  2  0
 29 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA223415

    NEXAVER

Associated Targets(Human)

LNCaP C4-2 (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.84Molecular Weight (Monoisotopic): 463.0911AlogP: 6.78#Rotatable Bonds: 6
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.55CX Basic pKa: 3.58CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.35

References

1. Torregrossa J, Bubley GJ, Jones GB..  (2006)  Microwave expedited synthesis of 5-aminocamptothecin analogs: Inhibitors of hypoxia inducible factor HIF-1alpha.,  16  (23): [PMID:16971123] [10.1016/j.bmcl.2006.08.103]

Source