[3H](-)Epigallocatecgin gallate

ID: ALA2235643

PubChem CID: 76308049

Max Phase: Preclinical

Molecular Formula: C22H17IO11

Molecular Weight: 584.27

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [3H]c1c(O)c(O)c(O)c([3H])c1C(=O)O[C@@H]1Cc2c(cc(O)c(I)c2O)O[C@@H]1c1c([3H])c(O)c(O)c(O)c1[3H]

Standard InChI:  InChI=1S/C22H17IO11/c23-17-10(24)6-15-9(18(17)29)5-16(21(33-15)7-1-11(25)19(30)12(26)2-7)34-22(32)8-3-13(27)20(31)14(28)4-8/h1-4,6,16,21,24-31H,5H2/t16-,21-/m1/s1/i1T,2T,3T,4T

Standard InChI Key:  MHXHIBRHWIVYQD-RDBRRRDWSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   14.8787   -4.6390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1729   -5.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1770   -5.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5885   -5.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2943   -4.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7058   -3.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8828   -6.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4671   -6.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7058   -4.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9959   -3.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5885   -5.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0001   -5.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2902   -3.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4589   -4.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7531   -5.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7614   -5.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4116   -3.4091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4671   -7.1030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9877   -2.5960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4198   -5.0476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3026   -6.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0474   -4.6514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3128   -7.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0256   -7.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6103   -7.5080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0323   -8.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7443   -8.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4478   -8.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4348   -7.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7223   -7.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1358   -7.0458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1611   -8.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7542   -9.5218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0442   -6.2835    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   15.5726   -3.4229    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.7076   -6.2450    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.3221   -8.7248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0001   -5.8726    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  4  5  1  6
  6 10  1  0
  7 11  1  0
  8  3  2  0
  9 12  1  0
 10 13  2  0
 11  4  1  0
 12  5  2  0
 13  5  1  0
 14  2  2  0
 15 16  2  0
 16 14  1  0
 17  6  1  0
 18  8  1  0
 19 10  1  0
 20  9  1  0
 11 21  1  6
 22 16  1  0
  3  7  1  0
  9  6  2  0
 15  8  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
 29 31  1  0
 28 32  1  0
 27 33  1  0
 15 34  1  0
 13 35  1  0
 30 36  1  0
 26 37  1  0
 12 38  1  0
M  ISO  4  35   3  36   3  37   3  38   3
M  END

Associated Targets(non-human)

Lung (635 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 584.27Molecular Weight (Monoisotopic): 583.9816AlogP: 2.84#Rotatable Bonds: 3
Polar Surface Area: 197.37Molecular Species: NEUTRALHBA: 11HBD: 8
#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 7.71CX Basic pKa: CX LogP: 4.01CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: 1.35

References

1. Toksoz F, Demir I, Bayrak E, Kocagozoglu G, Onursal M, Karademir G, Lambrecht FY.  (2012)  Radiolabeling of EGCG with 131I and biodistribution in rats,  21  (2): [10.1007/s00044-010-9535-7]

Source