The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[131I]-Epigallocatechin gallate ID: ALA2235644
PubChem CID: 76308050
Max Phase: Preclinical
Molecular Formula: C22H17IO11
Molecular Weight: 584.27
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O[C@@H]1Cc2c(cc(O)c([131I])c2O)O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1
Standard InChI: InChI=1S/C22H17IO11/c23-17-10(24)6-15-9(18(17)29)5-16(21(33-15)7-1-11(25)19(30)12(26)2-7)34-22(32)8-3-13(27)20(31)14(28)4-8/h1-4,6,16,21,24-31H,5H2/t16-,21-/m1/s1/i23+4
Standard InChI Key: MHXHIBRHWIVYQD-SEFFQDMFSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
14.8787 -4.6390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1729 -5.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1770 -5.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5885 -5.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2943 -4.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7058 -3.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8828 -6.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4671 -6.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7058 -4.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9959 -3.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5885 -5.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0001 -5.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2902 -3.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4589 -4.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7531 -5.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7614 -5.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4116 -3.4091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4671 -7.1030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9877 -2.5960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4198 -5.0476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3026 -6.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0474 -4.6514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3128 -7.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0256 -7.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6103 -7.5080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0323 -8.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7443 -8.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4478 -8.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4348 -7.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7223 -7.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1358 -7.0458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1611 -8.6858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7542 -9.5218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0442 -6.2835 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 0
4 5 1 6
6 10 1 0
7 11 1 0
8 3 2 0
9 12 1 0
10 13 2 0
11 4 1 0
12 5 2 0
13 5 1 0
14 2 2 0
15 16 2 0
16 14 1 0
17 6 1 0
18 8 1 0
19 10 1 0
20 9 1 0
11 21 1 6
22 16 1 0
3 7 1 0
9 6 2 0
15 8 1 0
21 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
29 31 1 0
28 32 1 0
27 33 1 0
15 34 1 0
M ISO 1 34 131
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.27Molecular Weight (Monoisotopic): 583.9816AlogP: 2.84#Rotatable Bonds: 3Polar Surface Area: 197.37Molecular Species: NEUTRALHBA: 11HBD: 8#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.71CX Basic pKa: ┄CX LogP: 4.01CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: 1.35
References 1. Toksoz F, Demir I, Bayrak E, Kocagozoglu G, Onursal M, Karademir G, Lambrecht FY. (2012) Radiolabeling of EGCG with 131I and biodistribution in rats, 21 (2): [10.1007/s00044-010-9535-7 ]