(+/-)-1-O-ethyl-3-O-[4-(4,5-dihydro-5-oxo-1,2,4-4H-oxadiazol-3-yl)phenyl]-2-O-tetradecylglycerol

ID: ALA223573

PubChem CID: 135540865

Max Phase: Preclinical

Molecular Formula: C27H44N2O5

Molecular Weight: 476.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCOC(COCC)COc1ccc(-c2noc(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C27H44N2O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-20-32-25(21-31-4-2)22-33-24-18-16-23(17-19-24)26-28-27(30)34-29-26/h16-19,25H,3-15,20-22H2,1-2H3,(H,28,29,30)

Standard InChI Key:  MMSFNIWHYXPAGS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    8.5367    0.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2562   -0.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9713    0.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9681    1.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2452    1.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5331    1.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6879   -0.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7777   -0.8907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5900   -1.0603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9959   -0.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4381    0.2712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8197   -0.2509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3369    1.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6255    1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9072    1.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1957    1.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4817    1.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7702    1.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0518    1.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6596    1.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3780    1.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0894    1.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8079    1.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5193    1.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2335    1.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9450    1.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6634    1.1836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8196    1.5859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0971    1.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3825    1.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3867    2.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6720    2.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6761    3.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9614    4.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
 17 18  1  0
  4  5  1  0
 18 19  1  0
  2  3  1  0
 19 20  1  0
  7  8  2  0
 20 21  1  0
  9 10  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
 11  7  1  0
 23 24  1  0
  5  6  2  0
 24 25  1  0
 10 12  2  0
 25 26  1  0
  6  1  1  0
 26 27  1  0
  1  2  2  0
 13 14  1  0
 28 29  1  0
  3  7  1  0
 29 30  1  0
 30 27  1  0
 14 15  1  0
 30 31  1  0
  8  9  1  0
 31 32  1  0
 15 16  1  0
 32 33  1  0
  3  4  2  0
 33 34  1  0
 28  6  1  0
M  END

Alternative Forms

  1. Parent:

    ALA223573

    ---

Associated Targets(Human)

PLA2G2A Tchem Phospholipase A2 group IIA (1079 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

PLA2G1B Phospholipase A2 group 1B (227 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.66Molecular Weight (Monoisotopic): 476.3250AlogP: 6.53#Rotatable Bonds: 21
Polar Surface Area: 86.58Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.94CX Basic pKa: CX LogP: 7.60CX LogD: 6.75
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -0.45

References

1. Touaibia M, Djimdé A, Cao F, Boilard E, Bezzine S, Lambeau G, Redeuilh C, Lamouri A, Massicot F, Chau F, Dong CZ, Heymans F..  (2007)  Inhibition of secreted phospholipase A2. 4-glycerol derivatives of 4,5-dihydro-3-(4-tetradecyloxybenzyl)-1,2,4-4H-oxadiazol-5-one with broad activities.,  50  (7): [PMID:17335183] [10.1021/jm060082n]

Source