The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(dimethylamino)phenyl)diazenyl)-N-(2-(2-(2-(2-hydroxyethoxy)ethoxy)ethoxy)ethyl)benzamide ID: ALA2236109
PubChem CID: 76333413
Max Phase: Preclinical
Molecular Formula: C23H32N4O5
Molecular Weight: 444.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(/N=N/c2ccc(C(=O)NCCOCCOCCOCCO)cc2)cc1
Standard InChI: InChI=1S/C23H32N4O5/c1-27(2)22-9-7-21(8-10-22)26-25-20-5-3-19(4-6-20)23(29)24-11-13-30-15-17-32-18-16-31-14-12-28/h3-10,28H,11-18H2,1-2H3,(H,24,29)/b26-25+
Standard InChI Key: JNQHPEGUFHQQLL-OCEACIFDSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
4.1654 -16.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8588 -16.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5731 -16.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5933 -15.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8932 -14.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1883 -15.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4868 -14.9577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4974 -14.1386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7622 -15.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2705 -16.6565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9881 -16.2656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6855 -16.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6618 -17.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3584 -17.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0769 -17.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 -16.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3974 -16.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7749 -17.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7558 -18.7839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4920 -17.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1899 -18.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9070 -17.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6050 -18.0332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3220 -17.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0200 -18.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7371 -17.6744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4350 -18.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1521 -17.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8500 -18.1326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5671 -17.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2651 -18.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9821 -17.7737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 0
3 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.53Molecular Weight (Monoisotopic): 444.2373AlogP: 2.94#Rotatable Bonds: 15Polar Surface Area: 104.98Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.58CX LogP: 2.73CX LogD: 2.73Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -0.92
References 1. Wang Y, Yang D, Chang A, Chan WK, Zhao B, Denison MS, Xue L. (2012) Synthesis of a ligandquencher conjugate for the ligand binding study of the aryl hydrocarbon receptor using a FRET assay, 21 (6): [10.1007/s00044-011-9575-7 ]