(2,6-dimethyl-4-(3-phenoxyphenyl)-1,4-dihydropyridine-3,5-diyl)bis(phenylmethanone)

ID: ALA2238469

PubChem CID: 10096882

Max Phase: Preclinical

Molecular Formula: C33H27NO3

Molecular Weight: 485.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)c2ccccc2)C(c2cccc(Oc3ccccc3)c2)C(C(=O)c2ccccc2)=C(C)N1

Standard InChI:  InChI=1S/C33H27NO3/c1-22-29(32(35)24-13-6-3-7-14-24)31(30(23(2)34-22)33(36)25-15-8-4-9-16-25)26-17-12-20-28(21-26)37-27-18-10-5-11-19-27/h3-21,31,34H,1-2H3

Standard InChI Key:  UZLKVYWHZWCDNA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    9.7376   -7.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7376   -8.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4516   -8.7945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1657   -8.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1657   -7.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4516   -7.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0217   -8.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4516   -6.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8775   -8.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8792   -7.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5946   -7.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8816   -6.3207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5905   -8.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3050   -8.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0237   -8.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0235   -7.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3084   -7.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1702   -5.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1706   -5.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4535   -4.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7347   -5.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7379   -5.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0237   -7.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0205   -6.3297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3129   -7.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6007   -7.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8904   -7.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8932   -8.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6120   -8.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3193   -8.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8835   -4.6685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5953   -5.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5919   -5.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3028   -6.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0166   -5.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0151   -5.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3037   -4.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  2  7  1  0
  6  8  1  0
  4  9  1  0
  5 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 11  1  0
  8 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22  8  1  0
  1 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 19 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Associated Targets(non-human)

Cacna1c Voltage-gated L-type calcium channel (1164 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.1991AlogP: 7.48#Rotatable Bonds: 7
Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.13CX LogD: 6.13
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -0.40

References

1. Bariwal JJ, Malhotra M, Molnar J, Jain KS, Shah AK, Bariwal JB.  (2012)  Synthesis, characterization and anticancer activity of 3-aza-analogues of DP-7,  21  (12): [10.1007/s00044-011-9925-5]

Source