The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2,6-dimethyl-4-(3-phenoxyphenyl)-1,4-dihydropyridine-3,5-diyl)bis(phenylmethanone) ID: ALA2238469
PubChem CID: 10096882
Max Phase: Preclinical
Molecular Formula: C33H27NO3
Molecular Weight: 485.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)c2ccccc2)C(c2cccc(Oc3ccccc3)c2)C(C(=O)c2ccccc2)=C(C)N1
Standard InChI: InChI=1S/C33H27NO3/c1-22-29(32(35)24-13-6-3-7-14-24)31(30(23(2)34-22)33(36)25-15-8-4-9-16-25)26-17-12-20-28(21-26)37-27-18-10-5-11-19-27/h3-21,31,34H,1-2H3
Standard InChI Key: UZLKVYWHZWCDNA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
9.7376 -7.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7376 -8.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4516 -8.7945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1657 -8.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1657 -7.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4516 -7.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0217 -8.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4516 -6.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8775 -8.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8792 -7.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5946 -7.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8816 -6.3207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5905 -8.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3050 -8.8059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0237 -8.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0235 -7.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3084 -7.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1702 -5.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1706 -5.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4535 -4.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7347 -5.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7379 -5.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0237 -7.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0205 -6.3297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3129 -7.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6007 -7.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8904 -7.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8932 -8.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6120 -8.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3193 -8.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8835 -4.6685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5953 -5.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5919 -5.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3028 -6.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0166 -5.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0151 -5.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3037 -4.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
2 7 1 0
6 8 1 0
4 9 1 0
5 10 1 0
10 11 1 0
10 12 2 0
11 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 11 1 0
8 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 8 1 0
1 23 1 0
23 24 2 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
19 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.1991AlogP: 7.48#Rotatable Bonds: 7Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.13CX LogD: 6.13Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -0.40
References 1. Bariwal JJ, Malhotra M, Molnar J, Jain KS, Shah AK, Bariwal JB. (2012) Synthesis, characterization and anticancer activity of 3-aza-analogues of DP-7, 21 (12): [10.1007/s00044-011-9925-5 ]