N1-phenylethyl-N4-(5-isoquinolyl)-1,4-cyclohexanediamine

ID: ALA224417

Max Phase: Preclinical

Molecular Formula: C23H27N3

Molecular Weight: 345.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(CCN[C@H]2CC[C@@H](Nc3cccc4cnccc34)CC2)cc1

Standard InChI:  InChI=1S/C23H27N3/c1-2-5-18(6-3-1)13-16-25-20-9-11-21(12-10-20)26-23-8-4-7-19-17-24-15-14-22(19)23/h1-8,14-15,17,20-21,25-26H,9-13,16H2/t20-,21+

Standard InChI Key:  IALIUHKRIFAJDB-OYRHEFFESA-N

Molfile:  

     RDKit          2D

 26 29  0  0  1  0  0  0  0  0999 V2000
   13.2901  -10.3781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0050  -10.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7215  -10.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7187   -9.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2912   -9.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0021   -9.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0001   -8.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2879   -7.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5764   -8.3273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5820   -9.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4312   -9.1312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1477   -9.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1490  -10.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8613  -10.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5764  -10.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5744   -9.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8575   -9.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2912  -10.7726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2920  -11.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0069  -12.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0077  -12.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2904  -13.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2908  -14.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0063  -14.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7228  -14.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7188  -13.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12 13  1  0
  5  6  1  0
  2  3  2  0
  6  7  1  0
  7  8  2  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
  3  4  1  0
 15 18  1  1
  8  9  1  0
 18 19  1  0
  4  6  2  0
 19 20  1  0
  9 10  2  0
 20 21  1  0
 10  5  1  0
 21 22  2  0
  1  2  1  0
 22 23  1  0
  4 11  1  0
 23 24  2  0
  5  1  2  0
 24 25  1  0
 12 11  1  1
 25 26  2  0
 26 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA224417

    ---

Associated Targets(Human)

ROCK2 Tclin Rho-associated protein kinase (137 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.49Molecular Weight (Monoisotopic): 345.2205AlogP: 4.79#Rotatable Bonds: 6
Polar Surface Area: 36.95Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.52CX LogP: 3.97CX LogD: 1.09
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.80

References

1. Iwakubo M, Takami A, Okada Y, Kawata T, Tagami Y, Sato M, Sugiyama T, Fukushima K, Taya S, Amano M, Kaibuchi K, Iijima H..  (2007)  Design and synthesis of rho kinase inhibitors (III).,  15  (2): [PMID:17084087] [10.1016/j.bmc.2006.10.028]
2. Qin J, Lei B, Xi L, Liu H, Yao X..  (2010)  Molecular modeling studies of Rho kinase inhibitors using molecular docking and 3D-QSAR analysis.,  45  (7): [PMID:20347188] [10.1016/j.ejmech.2010.02.059]

Source