The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-methyl 2-(2-(((5-(4-fluorophenoxy)-1,3-dimethyl-1H-pyrazol-4-yl)methyleneaminooxy)methyl)phenyl)-2-(methoxyimino)acetate ID: ALA2251524
PubChem CID: 11691015
Max Phase: Preclinical
Molecular Formula: C23H23FN4O5
Molecular Weight: 454.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)OC)c1ccccc1CO/N=C/c1c(C)nn(C)c1Oc1ccc(F)cc1
Standard InChI: InChI=1S/C23H23FN4O5/c1-15-20(22(28(2)26-15)33-18-11-9-17(24)10-12-18)13-25-32-14-16-7-5-6-8-19(16)21(27-31-4)23(29)30-3/h5-13H,14H2,1-4H3/b25-13+,27-21+
Standard InChI Key: JSQNTGLNBXQNBQ-WATRGXKZSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
12.2408 -18.6656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9137 -18.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6669 -17.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8415 -17.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5782 -18.1735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2321 -19.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3636 -16.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6955 -18.4508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1588 -16.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9783 -16.8325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4703 -16.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2898 -16.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7818 -15.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5991 -15.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0908 -15.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7633 -14.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9393 -14.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4511 -14.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9259 -16.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4332 -17.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7600 -17.8757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6138 -17.0224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2674 -18.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7452 -16.5521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2379 -15.8904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0573 -15.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8585 -19.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2378 -19.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4004 -20.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1830 -20.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8032 -20.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6376 -19.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3470 -21.6828 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
1 6 1 0
4 7 1 0
2 8 1 0
3 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
19 24 2 0
24 25 1 0
25 26 1 0
8 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.46Molecular Weight (Monoisotopic): 454.1652AlogP: 3.73#Rotatable Bonds: 9Polar Surface Area: 96.53Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.57CX LogP: 4.37CX LogD: 4.37Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.98
References 1. Li Y, Zhang HQ, Liu J, Yang XP, Liu ZJ.. (2006) Stereoselective synthesis and antifungal activities of (E)-alpha-(methoxyimino)benzeneacetate derivatives containing 1,3,5-substituted pyrazole ring., 54 (10): [PMID:19127737 ] [10.1021/jf060074f ]