The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propaquizafop ID: ALA2251597
Cas Number: 111479-05-1
PubChem CID: 16213016
Product Number: P114565, Order Now?
Max Phase: Preclinical
Molecular Formula: C22H22ClN3O5
Molecular Weight: 443.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=NOCCOC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1
Standard InChI: InChI=1S/C22H22ClN3O5/c1-14(2)26-29-11-10-28-22(27)15(3)30-17-5-7-18(8-6-17)31-21-13-24-20-12-16(23)4-9-19(20)25-21/h4-9,12-13,15H,10-11H2,1-3H3/t15-/m1/s1
Standard InChI Key: FROBCXTULYFHEJ-OAHLLOKOSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
11.8388 -16.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8144 -17.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5083 -17.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5591 -16.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1449 -16.0122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0941 -17.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3982 -17.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6780 -17.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9840 -17.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0104 -16.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7307 -15.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4246 -16.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3165 -15.9243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9003 -15.8768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5962 -16.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5698 -17.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8495 -17.5121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1556 -17.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4353 -17.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7394 -17.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7658 -16.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4861 -15.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1800 -16.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0191 -17.4206 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1713 -15.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8916 -14.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9180 -13.9945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6383 -13.6085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6627 -12.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9688 -12.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3830 -12.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 1
1 4 2 0
1 5 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
6 7 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
14 23 1 0
18 23 1 0
13 15 1 0
20 24 1 0
10 13 1 0
2 6 1 0
25 26 1 0
29 30 1 0
29 31 1 0
28 29 2 0
27 28 1 0
26 27 1 0
5 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.89Molecular Weight (Monoisotopic): 443.1248AlogP: 4.80#Rotatable Bonds: 9Polar Surface Area: 92.13Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.89CX LogP: 4.36CX LogD: 4.36Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.20Np Likeness Score: -1.18
References 1. Damalas CA.. (2009) Pyrithiobac reduces control of green foxtail (Setaria viridis) and bristly foxtail (Setaria verticillata) by propaquizafop, 28 (7): [10.1016/j.cropro.2009.03.004 ]