The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Bis(4-tert-butyl-benzyl)-[2-(2,4-dichlorophenyl)-3-[1,2,4]triazol-1-yl-propyl]amine ID: ALA2251922
PubChem CID: 23635101
Max Phase: Preclinical
Molecular Formula: C33H40Cl2N4
Molecular Weight: 563.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(CN(Cc2ccc(C(C)(C)C)cc2)CC(Cn2cncn2)c2ccc(Cl)cc2Cl)cc1
Standard InChI: InChI=1S/C33H40Cl2N4/c1-32(2,3)27-11-7-24(8-12-27)18-38(19-25-9-13-28(14-10-25)33(4,5)6)20-26(21-39-23-36-22-37-39)30-16-15-29(34)17-31(30)35/h7-17,22-23,26H,18-21H2,1-6H3
Standard InChI Key: PQFOCGTWWBRCCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
32.6862 -17.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6851 -17.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3973 -18.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1110 -17.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1082 -17.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3955 -16.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3930 -15.8029 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.9729 -18.2689 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.8185 -16.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5319 -17.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8154 -15.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5257 -15.3856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5350 -17.8495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8743 -18.3293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1298 -19.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9512 -19.1066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2006 -18.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2350 -15.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9453 -15.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6551 -15.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3649 -15.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3622 -14.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6439 -14.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9370 -14.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5226 -14.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8093 -14.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8092 -13.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0966 -12.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3854 -13.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3911 -14.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1042 -14.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6715 -12.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6673 -12.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9617 -13.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9571 -12.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0720 -14.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7859 -14.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0678 -13.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8608 -13.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
2 8 1 0
5 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
10 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
12 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
12 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
22 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.62Molecular Weight (Monoisotopic): 562.2630AlogP: 8.67#Rotatable Bonds: 9Polar Surface Area: 33.95Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.16CX LogP: 9.15CX LogD: 7.39Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -1.22
References 1. Arnoldi A, Dallavalle S, Merlini L, Musso L, Farina G, Moretti M, Jayasinghe L.. (2007) Synthesis and antifungal activity of a series of N-substituted [2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)]propylamines., 55 (20): [PMID:17896810 ] [10.1021/jf071631g ]