The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
bis(diethoxyphosphoryl)N1,N4-bis[(4-nitrophenyl)methyleneamino]piperazine-1,4-dicarboximidothioate ID: ALA2252241
PubChem CID: 76326374
Max Phase: Preclinical
Molecular Formula: C28H38N8O10P2S2
Molecular Weight: 772.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)S/C(=N\N=C\c1ccc([N+](=O)[O-])cc1)N1CCN(/C(=N\N=C\c2ccc([N+](=O)[O-])cc2)SP(=O)(OCC)OCC)CC1
Standard InChI: InChI=1S/C28H38N8O10P2S2/c1-5-43-47(41,44-6-2)49-27(31-29-21-23-9-13-25(14-10-23)35(37)38)33-17-19-34(20-18-33)28(50-48(42,45-7-3)46-8-4)32-30-22-24-11-15-26(16-12-24)36(39)40/h9-16,21-22H,5-8,17-20H2,1-4H3/b29-21+,30-22+,31-27-,32-28+
Standard InChI Key: KIYXIMJWIJGWFT-GGCFCEMTSA-N
Molfile:
RDKit 2D
50 52 0 0 0 0 0 0 0 0999 V2000
6.4963 -21.5773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6772 -21.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2535 -22.2665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6531 -22.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4723 -22.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8918 -22.2942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7109 -22.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1260 -21.6038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9467 -21.6006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3572 -22.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1780 -22.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5862 -21.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4049 -21.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8138 -22.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4056 -23.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5885 -23.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4344 -22.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0389 -21.5357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0629 -20.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4824 -19.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0869 -18.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5065 -17.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3256 -18.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7252 -18.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3016 -19.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0149 -22.9556 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1957 -22.9417 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.4584 -20.8327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1068 -23.0207 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7165 -23.7409 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.8996 -23.7629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1440 -24.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3410 -24.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7992 -22.2272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7752 -23.6424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3773 -22.9350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9745 -22.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1574 -22.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9581 -23.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5376 -24.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7808 -25.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4042 -25.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5102 -24.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6933 -24.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7463 -17.3038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3482 -16.5901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5634 -17.3158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6342 -22.3014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0414 -21.5929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0442 -23.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
3 17 1 0
17 18 2 0
18 28 1 0
28 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
26 27 1 0
7 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
30 33 1 0
27 34 2 0
27 35 1 0
27 36 1 0
36 37 1 0
37 38 1 0
35 39 1 0
39 40 1 0
33 41 1 0
41 42 1 0
31 43 1 0
43 44 1 0
45 46 2 0
45 47 1 0
23 45 1 0
48 49 2 0
48 50 1 0
14 48 1 0
M CHG 4 45 1 47 -1 48 1 50 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 772.74Molecular Weight (Monoisotopic): 772.1628AlogP: 7.03#Rotatable Bonds: 16Polar Surface Area: 213.26Molecular Species: NEUTRALHBA: 16HBD: ┄#RO5 Violations: 3HBA (Lipinski): 18HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 1.09CX LogP: 5.64CX LogD: 5.64Aromatic Rings: 2Heavy Atoms: 50QED Weighted: 0.06Np Likeness Score: -0.56
References 1. Chandra R, Pandey OP, Sengupta SK.. (2005) Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane., 53 (6): [PMID:15769154 ] [10.1021/jf040134m ]