The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
bis(diethoxyphosphoryl)N1,N4-bis[(2-chlorophenyl)methyleneamino]piperazine-1,4-dicarboximidothioate ID: ALA2252243
PubChem CID: 76311928
Max Phase: Preclinical
Molecular Formula: C28H38Cl2N6O6P2S2
Molecular Weight: 751.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)S/C(=N/N=C/c1ccccc1Cl)N1CCN(/C(=N\N=C\c2ccccc2Cl)SP(=O)(OCC)OCC)CC1
Standard InChI: InChI=1S/C28H38Cl2N6O6P2S2/c1-5-39-43(37,40-6-2)45-27(33-31-21-23-13-9-11-15-25(23)29)35-17-19-36(20-18-35)28(46-44(38,41-7-3)42-8-4)34-32-22-24-14-10-12-16-26(24)30/h9-16,21-22H,5-8,17-20H2,1-4H3/b31-21+,32-22+,33-27+,34-28+
Standard InChI Key: YQMRUXXIADYQHR-GNGADACMSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
36.0431 -21.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2240 -21.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8004 -22.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2000 -23.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0191 -23.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4386 -22.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2578 -22.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6814 -21.8403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2818 -21.1235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7054 -20.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3058 -19.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4867 -19.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0912 -18.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5107 -18.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3298 -18.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7295 -19.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9812 -22.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5857 -21.7710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6098 -20.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0293 -19.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6338 -18.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0533 -18.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8724 -18.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2721 -18.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8484 -19.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5617 -23.1909 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.7426 -23.1770 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
34.0052 -21.0680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6574 -23.2602 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.4765 -23.2741 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
38.8731 -23.9886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8970 -22.5734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2912 -23.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3460 -22.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3220 -23.8777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9241 -23.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5214 -22.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7042 -22.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5050 -23.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0845 -24.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6992 -22.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5164 -22.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6902 -24.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0867 -24.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8167 -18.9163 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
38.5466 -19.0134 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
3 17 1 0
17 18 2 0
18 28 1 0
28 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
26 27 1 0
7 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
30 33 1 0
27 34 2 0
27 35 1 0
27 36 1 0
36 37 1 0
37 38 1 0
35 39 1 0
39 40 1 0
33 41 1 0
41 42 1 0
31 43 1 0
43 44 1 0
21 45 1 0
16 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 751.64Molecular Weight (Monoisotopic): 750.1147AlogP: 8.52#Rotatable Bonds: 14Polar Surface Area: 126.98Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 1.09CX LogP: 6.97CX LogD: 6.97Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.08Np Likeness Score: -0.55
References 1. Chandra R, Pandey OP, Sengupta SK.. (2005) Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane., 53 (6): [PMID:15769154 ] [10.1021/jf040134m ]