bis(diethoxyphosphoryl)N1,N4-bis[(2-chlorophenyl)methyleneamino]piperazine-1,4-dicarboximidothioate

ID: ALA2252243

PubChem CID: 76311928

Max Phase: Preclinical

Molecular Formula: C28H38Cl2N6O6P2S2

Molecular Weight: 751.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)S/C(=N/N=C/c1ccccc1Cl)N1CCN(/C(=N\N=C\c2ccccc2Cl)SP(=O)(OCC)OCC)CC1

Standard InChI:  InChI=1S/C28H38Cl2N6O6P2S2/c1-5-39-43(37,40-6-2)45-27(33-31-21-23-13-9-11-15-25(23)29)35-17-19-36(20-18-35)28(46-44(38,41-7-3)42-8-4)34-32-22-24-14-10-12-16-26(24)30/h9-16,21-22H,5-8,17-20H2,1-4H3/b31-21+,32-22+,33-27+,34-28+

Standard InChI Key:  YQMRUXXIADYQHR-GNGADACMSA-N

Molfile:  

     RDKit          2D

 46 48  0  0  0  0  0  0  0  0999 V2000
   36.0431  -21.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2240  -21.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8004  -22.5017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2000  -23.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0191  -23.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4386  -22.5295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2578  -22.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6814  -21.8403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2818  -21.1235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.7054  -20.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3058  -19.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4867  -19.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0912  -18.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5107  -18.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3298  -18.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7295  -19.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9812  -22.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5857  -21.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6098  -20.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0293  -19.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6338  -18.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0533  -18.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8724  -18.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2721  -18.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8484  -19.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5617  -23.1909    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.7426  -23.1770    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   34.0052  -21.0680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6574  -23.2602    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.4765  -23.2741    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   38.8731  -23.9886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8970  -22.5734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2912  -23.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3460  -22.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3220  -23.8777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9241  -23.1703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5214  -22.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7042  -22.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5050  -23.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0845  -24.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6992  -22.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5164  -22.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6902  -24.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0867  -24.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8167  -18.9163    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.5466  -19.0134    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 17  1  0
 17 18  2  0
 18 28  1  0
 28 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 26  1  0
 26 27  1  0
  7 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 30 33  1  0
 27 34  2  0
 27 35  1  0
 27 36  1  0
 36 37  1  0
 37 38  1  0
 35 39  1  0
 39 40  1  0
 33 41  1  0
 41 42  1  0
 31 43  1  0
 43 44  1  0
 21 45  1  0
 16 46  1  0
M  END

Associated Targets(non-human)

Curvularia pallescens (106 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fusarium oxysporum (3998 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Colletotrichum falcatum (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 751.64Molecular Weight (Monoisotopic): 750.1147AlogP: 8.52#Rotatable Bonds: 14
Polar Surface Area: 126.98Molecular Species: NEUTRALHBA: 12HBD:
#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): #RO5 Violations (Lipinski): 3
CX Acidic pKa: CX Basic pKa: 1.09CX LogP: 6.97CX LogD: 6.97
Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.08Np Likeness Score: -0.55

References

1. Chandra R, Pandey OP, Sengupta SK..  (2005)  Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane.,  53  (6): [PMID:15769154] [10.1021/jf040134m]

Source