The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
bis(diethoxyphosphoryl)N1,N4-bis[benzylideneamino]piperazine-1,4-dicarboximidothioate ID: ALA2252356
PubChem CID: 76333636
Max Phase: Preclinical
Molecular Formula: C28H40N6O6P2S2
Molecular Weight: 682.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)S/C(=N/N=C/c1ccccc1)N1CCN(/C(=N\N=C\c2ccccc2)SP(=O)(OCC)OCC)CC1
Standard InChI: InChI=1S/C28H40N6O6P2S2/c1-5-37-41(35,38-6-2)43-27(31-29-23-25-15-11-9-12-16-25)33-19-21-34(22-20-33)28(44-42(36,39-7-3)40-8-4)32-30-24-26-17-13-10-14-18-26/h9-18,23-24H,5-8,19-22H2,1-4H3/b29-23+,30-24+,31-27+,32-28+
Standard InChI Key: WTQWIADFIILEBW-JKOZQQTKSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
34.0621 -8.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2429 -8.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8193 -9.2616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2189 -9.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0380 -9.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4576 -9.2893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2767 -9.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7003 -8.6002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3007 -7.8833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7244 -7.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3247 -6.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5056 -6.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1101 -5.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5296 -5.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3488 -5.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7484 -5.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0002 -9.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6047 -8.5308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6287 -7.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0482 -6.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6527 -5.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0722 -4.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8914 -5.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2910 -5.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8673 -6.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5806 -9.9507 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.7615 -9.9369 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
32.0242 -7.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6763 -10.0201 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.4955 -10.0339 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
36.8920 -10.7485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9160 -9.3333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3101 -10.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3649 -9.2223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3410 -10.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9430 -9.9301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5403 -9.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7231 -9.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5239 -10.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1034 -11.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7182 -9.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5354 -9.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7091 -10.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1056 -11.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
3 17 1 0
17 18 2 0
18 28 1 0
28 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
26 27 1 0
7 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
30 33 1 0
27 34 2 0
27 35 1 0
27 36 1 0
36 37 1 0
37 38 1 0
35 39 1 0
39 40 1 0
33 41 1 0
41 42 1 0
31 43 1 0
43 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 682.75Molecular Weight (Monoisotopic): 682.1926AlogP: 7.21#Rotatable Bonds: 14Polar Surface Area: 126.98Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 1.09CX LogP: 5.76CX LogD: 5.76Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.09Np Likeness Score: -0.41
References 1. Chandra R, Pandey OP, Sengupta SK.. (2005) Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane., 53 (6): [PMID:15769154 ] [10.1021/jf040134m ]