The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'1,N'4-bis(4-methoxybenzylidene)piperazine-1,4-bis(carbothiohydrazide) ID: ALA2252357
PubChem CID: 76329993
Max Phase: Preclinical
Molecular Formula: C22H26N6O2S2
Molecular Weight: 470.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=N/NC(=S)N2CCN(C(=S)N/N=C/c3ccc(OC)cc3)CC2)cc1
Standard InChI: InChI=1S/C22H26N6O2S2/c1-29-19-7-3-17(4-8-19)15-23-25-21(31)27-11-13-28(14-12-27)22(32)26-24-16-18-5-9-20(30-2)10-6-18/h3-10,15-16H,11-14H2,1-2H3,(H,25,31)(H,26,32)/b23-15+,24-16+
Standard InChI Key: XQZUHJIKMOJVBU-DFEHQXHXSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
7.8211 -13.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9957 -13.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5893 -13.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9957 -14.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8211 -14.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2320 -13.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0533 -13.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4670 -14.5715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4650 -13.1479 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.2883 -14.5704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6959 -13.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5172 -13.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9263 -14.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7468 -14.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1552 -13.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7413 -13.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9221 -13.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7680 -13.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3563 -13.1479 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3543 -14.5715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5330 -14.5704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1254 -13.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3040 -13.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8970 -13.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0764 -13.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6660 -13.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0780 -14.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8973 -14.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8489 -13.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4403 -13.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9724 -13.8541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3791 -13.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
3 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
15 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.62Molecular Weight (Monoisotopic): 470.1559AlogP: 2.44#Rotatable Bonds: 6Polar Surface Area: 73.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.59CX Basic pKa: 2.86CX LogP: 3.57CX LogD: 3.57Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -0.91
References 1. Chandra R, Pandey OP, Sengupta SK.. (2005) Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane., 53 (6): [PMID:15769154 ] [10.1021/jf040134m ]