The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
bis(diethoxyphosphoryl)N1,N4-bis[(4-methoxyphenyl)methyleneamino]piperazine-1,4-dicarboximidothioate ID: ALA2252358
PubChem CID: 76333637
Max Phase: Preclinical
Molecular Formula: C30H44N6O8P2S2
Molecular Weight: 742.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)S/C(=N/N=C/c1ccc(OC)cc1)N1CCN(/C(=N\N=C\c2ccc(OC)cc2)SP(=O)(OCC)OCC)CC1
Standard InChI: InChI=1S/C30H44N6O8P2S2/c1-7-41-45(37,42-8-2)47-29(33-31-23-25-11-15-27(39-5)16-12-25)35-19-21-36(22-20-35)30(48-46(38,43-9-3)44-10-4)34-32-24-26-13-17-28(40-6)18-14-26/h11-18,23-24H,7-10,19-22H2,1-6H3/b31-23+,32-24+,33-29+,34-30+
Standard InChI Key: PAEZEAOWSIVMPZ-DQYLKABQSA-N
Molfile:
RDKit 2D
48 50 0 0 0 0 0 0 0 0999 V2000
21.2553 -14.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4361 -14.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0125 -15.4689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4121 -16.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2313 -16.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6508 -15.4967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4699 -15.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8936 -14.8075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4939 -14.0907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9176 -13.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5180 -12.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6988 -12.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3033 -11.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7228 -11.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5420 -11.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9416 -11.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1934 -15.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7979 -14.7382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8219 -13.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2414 -12.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8459 -11.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2654 -11.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0846 -11.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4842 -11.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0605 -12.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7738 -16.1581 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.9547 -16.1442 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
19.2174 -14.0352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8695 -16.2274 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.6887 -16.2413 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
24.0852 -16.9558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1092 -15.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5034 -16.2406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5582 -15.4297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5342 -16.8449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1363 -16.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7335 -15.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9163 -15.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7171 -16.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2966 -17.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9114 -15.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7286 -15.5319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9023 -16.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2988 -17.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5036 -10.5118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1055 -9.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3263 -10.5266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7469 -9.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
3 17 1 0
17 18 2 0
18 28 1 0
28 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
26 27 1 0
7 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
30 33 1 0
27 34 2 0
27 35 1 0
27 36 1 0
36 37 1 0
37 38 1 0
35 39 1 0
39 40 1 0
33 41 1 0
41 42 1 0
31 43 1 0
43 44 1 0
23 45 1 0
45 46 1 0
14 47 1 0
47 48 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 742.80Molecular Weight (Monoisotopic): 742.2137AlogP: 7.23#Rotatable Bonds: 16Polar Surface Area: 145.44Molecular Species: NEUTRALHBA: 14HBD: ┄#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 1.09CX LogP: 5.45CX LogD: 5.45Aromatic Rings: 2Heavy Atoms: 48QED Weighted: 0.07Np Likeness Score: -0.38
References 1. Chandra R, Pandey OP, Sengupta SK.. (2005) Organophosphorus derivatives containing piperazine dithiosemicarbazones as chemotherapeutants against fungal pathogens of sugarcane., 53 (6): [PMID:15769154 ] [10.1021/jf040134m ]