2-chloro-N-(4-chloro-2-(2-(4-fluorobenzylidene)hydrazinecarbonyl)-6-methylphenyl)nicotinamide

ID: ALA2252867

PubChem CID: 76333658

Max Phase: Preclinical

Molecular Formula: C21H15Cl2FN4O2

Molecular Weight: 445.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)cc(C(=O)N/N=C\c2ccc(F)cc2)c1NC(=O)c1cccnc1Cl

Standard InChI:  InChI=1S/C21H15Cl2FN4O2/c1-12-9-14(22)10-17(18(12)27-20(29)16-3-2-8-25-19(16)23)21(30)28-26-11-13-4-6-15(24)7-5-13/h2-11H,1H3,(H,27,29)(H,28,30)/b26-11-

Standard InChI Key:  ZXBLBMWSFGZZOI-RAWMCFOBSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   17.1555   -1.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1543   -1.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8624   -2.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5720   -1.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5692   -1.0240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8606   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2804   -2.2542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.8622   -3.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1544   -3.4818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5698   -3.4821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5696   -4.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8613   -4.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8608   -5.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5689   -5.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2791   -5.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2762   -4.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1548   -4.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5698   -6.7466    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.9819   -4.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6916   -4.6947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9779   -3.4724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3973   -4.2827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1070   -4.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1109   -5.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4052   -5.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4088   -6.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1190   -7.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8270   -6.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8200   -5.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1240   -7.9519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 14 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
M  END

Associated Targets(non-human)

Ralstonia solanacearum (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.28Molecular Weight (Monoisotopic): 444.0556AlogP: 4.85#Rotatable Bonds: 5
Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.92CX Basic pKa: 0.79CX LogP: 5.57CX LogD: 5.57
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -2.17

References

1. Wu J, Kang S, Song B, Hu D, He M, Jin L, Yang S..  (2012)  Synthesis and antibacterial activity against ralstonia solanacearum for novel hydrazone derivatives containing a pyridine moiety.,  (28): [PMID:22483270] [10.1186/1752-153x-6-28]

Source