2-chloro-N-(4-chloro-2-methyl-6-(2-(3-(trifluoromethyl)benzylidene)hydrazinecarbonyl)phenyl)nicotinamide

ID: ALA2252869

PubChem CID: 76311957

Max Phase: Preclinical

Molecular Formula: C22H15Cl2F3N4O2

Molecular Weight: 495.29

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)cc(C(=O)N/N=C\c2cccc(C(F)(F)F)c2)c1NC(=O)c1cccnc1Cl

Standard InChI:  InChI=1S/C22H15Cl2F3N4O2/c1-12-8-15(23)10-17(18(12)30-20(32)16-6-3-7-28-19(16)24)21(33)31-29-11-13-4-2-5-14(9-13)22(25,26)27/h2-11H,1H3,(H,30,32)(H,31,33)/b29-11-

Standard InChI Key:  RMFYLTNRCIWXRG-KYMQWJLESA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   35.2327   -0.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2316   -1.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9396   -2.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6493   -1.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6465   -0.9167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9378   -0.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3576   -2.1469    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.9394   -2.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2316   -3.3744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6470   -3.3748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6468   -4.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9386   -4.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9381   -5.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6462   -5.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3564   -5.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3534   -4.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2321   -4.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6471   -6.6393    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.0591   -4.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7688   -4.5874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0552   -3.3650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4745   -4.1754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1842   -4.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1882   -5.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4824   -5.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4860   -6.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1962   -7.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9043   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8972   -5.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6154   -7.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6222   -7.8308    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.3197   -6.5992    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.3206   -7.4208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 14 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(non-human)

Ralstonia solanacearum (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.29Molecular Weight (Monoisotopic): 494.0524AlogP: 5.73#Rotatable Bonds: 5
Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.92CX Basic pKa: 0.74CX LogP: 6.31CX LogD: 6.31
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: -2.09

References

1. Wu J, Kang S, Song B, Hu D, He M, Jin L, Yang S..  (2012)  Synthesis and antibacterial activity against ralstonia solanacearum for novel hydrazone derivatives containing a pyridine moiety.,  (28): [PMID:22483270] [10.1186/1752-153x-6-28]

Source