The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(4-tert-butylbenzylidene)hydrazinecarbonyl)-4-chloro-6-methylphenyl)-2-chloronicotinamide ID: ALA2252870
PubChem CID: 76311958
Max Phase: Preclinical
Molecular Formula: C25H24Cl2N4O2
Molecular Weight: 483.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cl)cc(C(=O)N/N=C\c2ccc(C(C)(C)C)cc2)c1NC(=O)c1cccnc1Cl
Standard InChI: InChI=1S/C25H24Cl2N4O2/c1-15-12-18(26)13-20(21(15)30-23(32)19-6-5-11-28-22(19)27)24(33)31-29-14-16-7-9-17(10-8-16)25(2,3)4/h5-14H,1-4H3,(H,30,32)(H,31,33)/b29-14-
Standard InChI Key: POGPQJXTZAGWOD-NUJZUDFISA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.0705 -9.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0693 -10.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7774 -10.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4870 -10.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4842 -9.2372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7756 -8.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1954 -10.4674 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.7772 -11.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0693 -11.6949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4848 -11.6953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4846 -12.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7763 -12.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7758 -13.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4839 -14.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1941 -13.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1911 -12.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0698 -12.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4848 -14.9598 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.8969 -12.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6065 -12.9079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8929 -11.6855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3123 -12.4959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0219 -12.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0259 -13.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3201 -14.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3238 -14.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0340 -15.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7420 -14.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7349 -14.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0390 -16.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3338 -16.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7492 -16.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0328 -16.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
3 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
12 17 1 0
14 18 1 0
16 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.40Molecular Weight (Monoisotopic): 482.1276AlogP: 6.01#Rotatable Bonds: 5Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.92CX Basic pKa: 1.07CX LogP: 6.97CX LogD: 6.97Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -1.93
References 1. Wu J, Kang S, Song B, Hu D, He M, Jin L, Yang S.. (2012) Synthesis and antibacterial activity against ralstonia solanacearum for novel hydrazone derivatives containing a pyridine moiety., 6 (28): [PMID:22483270 ] [10.1186/1752-153x-6-28 ]