2-chloro-N-(4-chloro-2-(2-(2,3-dimethoxybenzylidene)hydrazinecarbonyl)-6-methylphenyl)nicotinamide

ID: ALA2252873

PubChem CID: 76333659

Max Phase: Preclinical

Molecular Formula: C23H20Cl2N4O4

Molecular Weight: 487.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(/C=N\NC(=O)c2cc(Cl)cc(C)c2NC(=O)c2cccnc2Cl)c1OC

Standard InChI:  InChI=1S/C23H20Cl2N4O4/c1-13-10-15(24)11-17(19(13)28-22(30)16-7-5-9-26-21(16)25)23(31)29-27-12-14-6-4-8-18(32-2)20(14)33-3/h4-12H,1-3H3,(H,28,30)(H,29,31)/b27-12-

Standard InChI Key:  AUIIUOKEGLWPEO-PPDIBHTLSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   28.2536   -9.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2524   -9.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9605  -10.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6702   -9.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6673   -9.0144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9587   -8.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3785  -10.2445    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.9603  -11.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2525  -11.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6679  -11.4724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6677  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9595  -12.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9589  -13.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6671  -13.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3772  -13.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3743  -12.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2529  -12.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6680  -14.7369    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.0800  -12.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7897  -12.6850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0760  -11.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4954  -12.2730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2051  -12.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2090  -13.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5033  -13.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5069  -14.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2171  -15.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9252  -14.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9181  -13.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6215  -13.4777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3334  -13.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6363  -15.1113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6431  -15.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 14 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Ralstonia solanacearum (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.34Molecular Weight (Monoisotopic): 486.0862AlogP: 4.73#Rotatable Bonds: 7
Polar Surface Area: 101.91Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.92CX Basic pKa: 0.70CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -1.69

References

1. Wu J, Kang S, Song B, Hu D, He M, Jin L, Yang S..  (2012)  Synthesis and antibacterial activity against ralstonia solanacearum for novel hydrazone derivatives containing a pyridine moiety.,  (28): [PMID:22483270] [10.1186/1752-153x-6-28]

Source