2-chloro-N-(4-chloro-2-(2-(2-chlorobenzylidene)hydrazinecarbonyl)-6-methylphenyl)nicotinamide

ID: ALA2252877

PubChem CID: 76311960

Max Phase: Preclinical

Molecular Formula: C21H15Cl3N4O2

Molecular Weight: 461.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)cc(C(=O)N/N=C\c2ccccc2Cl)c1NC(=O)c1cccnc1Cl

Standard InChI:  InChI=1S/C21H15Cl3N4O2/c1-12-9-14(22)10-16(18(12)27-20(29)15-6-4-8-25-19(15)24)21(30)28-26-11-13-5-2-3-7-17(13)23/h2-11H,1H3,(H,27,29)(H,28,30)/b26-11-

Standard InChI Key:  PIXRJWZTBOCEBS-RAWMCFOBSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    8.8143   -1.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8132   -2.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5212   -2.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2309   -2.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2281   -1.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5195   -0.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9393   -2.5390    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.5210   -3.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8132   -3.7665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2287   -3.7669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2285   -4.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5202   -4.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5197   -5.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2278   -6.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9380   -5.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9350   -4.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8137   -4.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2287   -7.0314    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.6408   -4.5743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3504   -4.9795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6368   -3.7571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0562   -4.5675    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7658   -4.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7698   -5.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0640   -6.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0676   -7.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7779   -7.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4859   -7.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4788   -6.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1823   -5.7722    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 14 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
M  END

Associated Targets(non-human)

Ralstonia solanacearum (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.74Molecular Weight (Monoisotopic): 460.0261AlogP: 5.37#Rotatable Bonds: 5
Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.92CX Basic pKa: 0.67CX LogP: 6.03CX LogD: 6.03
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -2.08

References

1. Wu J, Kang S, Song B, Hu D, He M, Jin L, Yang S..  (2012)  Synthesis and antibacterial activity against ralstonia solanacearum for novel hydrazone derivatives containing a pyridine moiety.,  (28): [PMID:22483270] [10.1186/1752-153x-6-28]

Source