(1'R,3R,3'S,7'S,12'R)-12'-hydroxy-4',4',7,7,12',14'-hexamethyl-2,7-dihydro-1H-9',14'-diazaspiro[[1,4]dioxepino[2,3-g]indole-3,5'-tetracyclo[5.5.2.0^{1,9}.0^{3,7}]tetradecane]-2,10',13'-trione

ID: ALA2252927

PubChem CID: 14337025

Max Phase: Preclinical

Molecular Formula: C28H33N3O6

Molecular Weight: 507.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)[C@]23C[C@H]4C(C)(C)[C@@]5(C[C@@]41CN2C(=O)C[C@@]3(C)O)C(=O)Nc1c5ccc2c1OC=CC(C)(C)O2

Standard InChI:  InChI=1S/C28H33N3O6/c1-23(2)9-10-36-20-16(37-23)8-7-15-19(20)29-21(33)27(15)13-26-14-31-18(32)12-25(5,35)28(31,22(34)30(26)6)11-17(26)24(27,3)4/h7-10,17,35H,11-14H2,1-6H3,(H,29,33)/t17-,25+,26+,27+,28-/m0/s1

Standard InChI Key:  HHMKOJPJOSZYET-MGUBYGHDSA-N

Molfile:  

     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
    5.4589  -15.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1946  -15.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8722  -14.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2385  -15.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9518  -15.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6687  -15.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6690  -16.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4602  -16.7200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9480  -16.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2376  -16.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9536  -16.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0795  -17.7001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4645  -16.7696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5227  -18.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2254  -17.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6971  -18.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4239  -17.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8077  -18.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7735  -16.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2503  -14.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0699  -14.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5906  -13.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9514  -13.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4814  -12.6338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2978  -12.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6765  -12.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0916  -11.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -11.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7769  -15.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0163  -14.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4645  -13.2484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1413  -13.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8017  -13.1328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8743  -12.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3836  -11.6140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3836  -12.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6252  -11.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 21  1  0
 20  3  1  0
  1  3  1  6
  4 10  2  0
 11  7  2  0
  6  5  2  0
  5  4  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  1  1  0
  1  6  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  2  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  9 19  2  0
 20 21  1  0
 20 23  1  0
 21 22  1  1
 22 25  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
  2 30  1  0
 20 31  1  6
 31 32  1  0
 25 32  1  6
 32 33  2  0
 31 34  1  0
 26 35  1  1
 26 36  1  0
 28 37  2  0
M  END

Associated Targets(non-human)

Oncopeltus fasciatus (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.59Molecular Weight (Monoisotopic): 507.2369AlogP: 2.32#Rotatable Bonds:
Polar Surface Area: 108.41Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.59CX Basic pKa: CX LogP: 0.88CX LogD: 0.88
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.56Np Likeness Score: 1.83

References

1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J..  (2006)  Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae.,  54  (8): [PMID:16608209] [10.1021/jf0530998]

Source