N-oxide Paraherquamide

ID: ALA2252928

PubChem CID: 76315504

Max Phase: Preclinical

Molecular Formula: C28H35N3O6

Molecular Weight: 509.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)[C@]23C[C@H]4C(C)(C)[C@@]5(C[C@@]41C[N+]2([O-])CC[C@@]3(C)O)C(=O)Nc1c5ccc2c1OC=CC(C)(C)O2

Standard InChI:  InChI=1S/C28H35N3O6/c1-23(2)10-12-36-20-17(37-23)8-7-16-19(20)29-21(32)27(16)14-26-15-31(35)11-9-25(5,34)28(31,22(33)30(26)6)13-18(26)24(27,3)4/h7-8,10,12,18,34H,9,11,13-15H2,1-6H3,(H,29,32)/t18-,25+,26+,27+,28-,31?/m0/s1

Standard InChI Key:  IFVZXHLMGGKUOX-APYVQCPJSA-N

Molfile:  

     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
   28.9429   -4.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6786   -4.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3562   -4.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7224   -5.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4358   -4.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1526   -5.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1529   -5.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9441   -6.2410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4319   -5.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7215   -5.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4375   -6.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5634   -7.2211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9484   -6.2906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0066   -7.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7094   -7.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1810   -7.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9078   -6.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2917   -7.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2574   -5.5704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7343   -3.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5539   -3.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0745   -3.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4353   -2.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9653   -2.1547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7817   -2.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1605   -1.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5756   -0.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8364   -1.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2608   -5.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5002   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9484   -2.7694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6252   -2.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2856   -2.6538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3582   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8675   -1.1350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8675   -1.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2550   -1.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 21  1  0
 20  3  1  0
  1  3  1  6
  4 10  2  0
 11  7  2  0
  6  5  2  0
  5  4  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  1  1  0
  1  6  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  2  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  9 19  2  0
 20 21  1  0
 20 23  1  0
 21 22  1  1
 22 25  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
  2 30  1  0
 20 31  1  6
 31 32  1  0
 25 32  1  6
 32 33  2  0
 31 34  1  0
 26 35  1  1
 26 36  1  0
 24 37  1  0
M  CHG  2  24   1  37  -1
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Oncopeltus fasciatus (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.60Molecular Weight (Monoisotopic): 509.2526AlogP: 2.81#Rotatable Bonds:
Polar Surface Area: 111.16Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.55CX Basic pKa: 1.91CX LogP: 0.48CX LogD: 0.48
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: 1.79

References

1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J..  (2006)  Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae.,  54  (8): [PMID:16608209] [10.1021/jf0530998]

Source