The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-oxide Paraherquamide ID: ALA2252928
PubChem CID: 76315504
Max Phase: Preclinical
Molecular Formula: C28H35N3O6
Molecular Weight: 509.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)[C@]23C[C@H]4C(C)(C)[C@@]5(C[C@@]41C[N+]2([O-])CC[C@@]3(C)O)C(=O)Nc1c5ccc2c1OC=CC(C)(C)O2
Standard InChI: InChI=1S/C28H35N3O6/c1-23(2)10-12-36-20-17(37-23)8-7-16-19(20)29-21(32)27(16)14-26-15-31(35)11-9-25(5,34)28(31,22(33)30(26)6)13-18(26)24(27,3)4/h7-8,10,12,18,34H,9,11,13-15H2,1-6H3,(H,29,32)/t18-,25+,26+,27+,28-,31?/m0/s1
Standard InChI Key: IFVZXHLMGGKUOX-APYVQCPJSA-N
Molfile:
RDKit 2D
37 43 0 0 0 0 0 0 0 0999 V2000
28.9429 -4.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6786 -4.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3562 -4.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7224 -5.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4358 -4.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1526 -5.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1529 -5.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9441 -6.2410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4319 -5.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7215 -5.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4375 -6.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5634 -7.2211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9484 -6.2906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0066 -7.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7094 -7.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1810 -7.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9078 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2917 -7.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2574 -5.5704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7343 -3.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5539 -3.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0745 -3.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4353 -2.8002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9653 -2.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7817 -2.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1605 -1.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5756 -0.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8364 -1.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2608 -5.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5002 -4.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9484 -2.7694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6252 -2.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2856 -2.6538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3582 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8675 -1.1350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8675 -1.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2550 -1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 21 1 0
20 3 1 0
1 3 1 6
4 10 2 0
11 7 2 0
6 5 2 0
5 4 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 1 1 0
1 6 1 0
10 11 1 0
11 12 1 0
10 13 1 0
12 14 1 0
13 15 1 0
14 16 2 0
15 16 1 0
15 17 1 0
15 18 1 0
9 19 2 0
20 21 1 0
20 23 1 0
21 22 1 1
22 25 1 0
24 23 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
2 29 1 0
2 30 1 0
20 31 1 6
31 32 1 0
25 32 1 6
32 33 2 0
31 34 1 0
26 35 1 1
26 36 1 0
24 37 1 0
M CHG 2 24 1 37 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.60Molecular Weight (Monoisotopic): 509.2526AlogP: 2.81#Rotatable Bonds: ┄Polar Surface Area: 111.16Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.55CX Basic pKa: 1.91CX LogP: 0.48CX LogD: 0.48Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: 1.79
References 1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J.. (2006) Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae., 54 (8): [PMID:16608209 ] [10.1021/jf0530998 ]