The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Paraherquamide E ID: ALA2252929
Cas Number: 125600-53-5
PubChem CID: 9898611
Product Number: P329357, Order Now?
Max Phase: Preclinical
Molecular Formula: C28H35N3O4
Molecular Weight: 477.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1CCN2C[C@]34C[C@@]5(C(=O)Nc6c5ccc5c6OC=CC(C)(C)O5)C(C)(C)[C@@H]3C[C@]12C(=O)N4C
Standard InChI: InChI=1S/C28H35N3O4/c1-16-9-11-31-15-26-14-27(25(4,5)19(26)13-28(16,31)23(33)30(26)6)17-7-8-18-21(20(17)29-22(27)32)34-12-10-24(2,3)35-18/h7-8,10,12,16,19H,9,11,13-15H2,1-6H3,(H,29,32)/t16-,19-,26+,27+,28+/m0/s1
Standard InChI Key: XNXXZRQPTAQILV-PYGUQFFJSA-N
Molfile:
RDKit 2D
35 41 0 0 0 0 0 0 0 0999 V2000
20.9710 -5.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7132 -5.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3859 -5.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7512 -6.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4658 -5.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1816 -6.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1819 -6.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9729 -7.1599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4644 -6.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7540 -6.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4685 -7.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5927 -8.1351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9781 -7.2101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0383 -8.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7366 -8.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2119 -8.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9342 -7.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3181 -8.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2905 -6.4873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7652 -4.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5867 -4.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1072 -3.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4684 -3.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9967 -3.0705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8133 -3.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1895 -2.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6071 -1.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8701 -2.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2916 -6.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5336 -5.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9752 -3.6854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6574 -3.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3166 -3.5707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3890 -3.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0087 -2.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 21 1 0
20 3 1 0
1 3 1 6
4 10 2 0
11 7 2 0
6 5 2 0
5 4 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 1 1 0
1 6 1 0
10 11 1 0
11 12 1 0
10 13 1 0
12 14 1 0
13 15 1 0
14 16 2 0
15 16 1 0
15 17 1 0
15 18 1 0
9 19 2 0
20 21 1 0
20 23 1 0
21 22 1 1
22 25 1 0
24 23 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
2 29 1 0
2 30 1 0
20 31 1 6
31 32 1 0
25 32 1 6
32 33 2 0
31 34 1 0
26 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2628AlogP: 3.68#Rotatable Bonds: ┄Polar Surface Area: 71.11Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.59CX Basic pKa: 8.68CX LogP: 2.84CX LogD: 1.54Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.62Np Likeness Score: 1.77
References 1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J.. (2006) Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae., 54 (8): [PMID:16608209 ] [10.1021/jf0530998 ]