Paraherquamide E

ID: ALA2252929

Cas Number: 125600-53-5

PubChem CID: 9898611

Product Number: P329357, Order Now?

Max Phase: Preclinical

Molecular Formula: C28H35N3O4

Molecular Weight: 477.61

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1CCN2C[C@]34C[C@@]5(C(=O)Nc6c5ccc5c6OC=CC(C)(C)O5)C(C)(C)[C@@H]3C[C@]12C(=O)N4C

Standard InChI:  InChI=1S/C28H35N3O4/c1-16-9-11-31-15-26-14-27(25(4,5)19(26)13-28(16,31)23(33)30(26)6)17-7-8-18-21(20(17)29-22(27)32)34-12-10-24(2,3)35-18/h7-8,10,12,16,19H,9,11,13-15H2,1-6H3,(H,29,32)/t16-,19-,26+,27+,28+/m0/s1

Standard InChI Key:  XNXXZRQPTAQILV-PYGUQFFJSA-N

Molfile:  

     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
   20.9710   -5.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7132   -5.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3859   -5.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7512   -6.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4658   -5.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1816   -6.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1819   -6.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9729   -7.1599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4644   -6.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7540   -6.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4685   -7.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5927   -8.1351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9781   -7.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0383   -8.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7366   -8.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2119   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9342   -7.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3181   -8.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2905   -6.4873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7652   -4.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5867   -4.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1072   -3.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4684   -3.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9967   -3.0705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8133   -3.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1895   -2.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6071   -1.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8701   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2916   -6.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5336   -5.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9752   -3.6854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6574   -3.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3166   -3.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3890   -3.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0087   -2.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 21  1  0
 20  3  1  0
  1  3  1  6
  4 10  2  0
 11  7  2  0
  6  5  2  0
  5  4  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  1  1  0
  1  6  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  2  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  9 19  2  0
 20 21  1  0
 20 23  1  0
 21 22  1  1
 22 25  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
  2 30  1  0
 20 31  1  6
 31 32  1  0
 25 32  1  6
 32 33  2  0
 31 34  1  0
 26 35  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Oncopeltus fasciatus (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2628AlogP: 3.68#Rotatable Bonds:
Polar Surface Area: 71.11Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.59CX Basic pKa: 8.68CX LogP: 2.84CX LogD: 1.54
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.62Np Likeness Score: 1.77

References

1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J..  (2006)  Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae.,  54  (8): [PMID:16608209] [10.1021/jf0530998]

Source