Paraherquamide B

ID: ALA2252930

PubChem CID: 11812622

Max Phase: Preclinical

Molecular Formula: C27H33N3O4

Molecular Weight: 463.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)[C@@]23CCCN2C[C@@]12C[C@@]1(C(=O)Nc4c1ccc1c4OC=CC(C)(C)O1)C(C)(C)[C@@H]2C3

Standard InChI:  InChI=1S/C27H33N3O4/c1-23(2)10-12-33-20-17(34-23)8-7-16-19(20)28-21(31)27(16)14-26-15-30-11-6-9-25(30,22(32)29(26)5)13-18(26)24(27,3)4/h7-8,10,12,18H,6,9,11,13-15H2,1-5H3,(H,28,31)/t18-,25-,26+,27+/m0/s1

Standard InChI Key:  JPDNNPOSGMWCHG-NNSXXJBVSA-N

Molfile:  

     RDKit          2D

 34 40  0  0  0  0  0  0  0  0999 V2000
   13.1026   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8424   -5.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5200   -5.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8862   -6.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5954   -5.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3123   -6.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3126   -7.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1038   -7.3430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5916   -6.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8853   -7.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5972   -7.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7273   -8.3230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1122   -7.3926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1663   -8.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8691   -8.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3407   -8.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0675   -7.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4514   -8.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4171   -6.6724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8981   -4.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7177   -4.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2384   -4.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5991   -3.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1250   -3.2567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9414   -3.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3202   -2.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7394   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0002   -2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4205   -6.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6640   -5.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1081   -3.8713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7891   -4.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4453   -3.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5220   -3.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 21  1  0
 20  3  1  0
  1  3  1  6
  4 10  2  0
 11  7  2  0
  6  5  2  0
  5  4  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  1  1  0
  1  6  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  2  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  9 19  2  0
 20 21  1  0
 20 23  1  0
 21 22  1  1
 22 25  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
  2 29  1  0
  2 30  1  0
 20 31  1  6
 31 32  1  0
 25 32  1  6
 32 33  2  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Oncopeltus fasciatus (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.58Molecular Weight (Monoisotopic): 463.2471AlogP: 3.44#Rotatable Bonds:
Polar Surface Area: 71.11Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.59CX Basic pKa: 8.37CX LogP: 2.47CX LogD: 1.46
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.64Np Likeness Score: 1.81

References

1. López-Gresa MP, González MC, Ciavatta L, Ayala I, Moya P, Primo J..  (2006)  Insecticidal activity of Paraherquamides, including paraherquamide H and paraherquamide I, two new alkaloids isolated from Penicillium cluniae.,  54  (8): [PMID:16608209] [10.1021/jf0530998]

Source